|
|
| | (2R,3S)-1-(diphenylmethyl)-2-methylazetidin-3-ol Basic information |
| Product Name: | (2R,3S)-1-(diphenylmethyl)-2-methylazetidin-3-ol | | Synonyms: | (2R,3S)-1-(diphenylmethyl)-2-methylazetidin-3-ol;3-Azetidinol, 1-(diphenylmethyl)-2-methyl-, (2R-trans)-;(2R,3S)-1-(diphenylmethyl)-3-hydroxy-2-methylazetidine;3-Azetidinol, 1-(diphenylmethyl)-2-methyl-, (2R,3S)-;(2R,3S)-1-(diphenylmethyl)-2-methylazetidin-3-ol - [D82683] | | CAS: | 138876-39-8 | | MF: | C17H19NO | | MW: | 253.34 | | EINECS: | | | Product Categories: | | | Mol File: | 138876-39-8.mol |  |
| | (2R,3S)-1-(diphenylmethyl)-2-methylazetidin-3-ol Chemical Properties |
| Boiling point | 361.2±42.0 °C(Predicted) | | density | 1.145±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 14.27±0.40(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C17H19NO/c1-13-16(19)12-18(13)17(14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-11,13,16-17,19H,12H2,1H3/t13-,16+/m1/s1 | | InChIKey | RVJIUWJMJDLQIP-CJNGLKHVSA-N | | SMILES | N1(C(C2=CC=CC=C2)C2=CC=CC=C2)C[C@H](O)[C@H]1C | | CAS DataBase Reference | 138876-39-8 |
| | (2R,3S)-1-(diphenylmethyl)-2-methylazetidin-3-ol Usage And Synthesis |
| | (2R,3S)-1-(diphenylmethyl)-2-methylazetidin-3-ol Preparation Products And Raw materials |
|