| Company Name: |
Wuxi Asia Peptide Biotechnology Limited Company
|
| Tel: |
0510-83583050 13771062561 |
| Email: |
willsun@peptide-search.com |
| Products Intro: |
Product Name:L-PENICILLAMINE DISULFIDE (disulfide bond)
CAS:113626-33-8
Purity:98% HPLC Package:100g，500g
|
|
| | L-PENICILLAMINE DISULFIDE (disulfide bond) Basic information |
| Product Name: | L-PENICILLAMINE DISULFIDE (disulfide bond) | | Synonyms: | (2R)-2-amino-3-[[(1R)-1-amino-1-carboxy-2-methylpropan-2-yl]disulfanyl]-3-methylbutanoic acid;L-PENICILLAMINE DISULFIDE (disulfide bond);3,3'-Dithiobis-L-valine;Pencillamine Disulphide Impurity;L-Valine, 3,3'-dithiobis- (9CI);L-penicillamine disulfide;L-Valine, 3,3'-dithiobis-;Pencillamine Disulphide ImpurityQ: What is
Pencillamine Disulphide Impurity Q: What is the CAS Number of
Pencillamine Disulphide Impurity Q: What is the storage condition of
Pencillamine Disulphide Impurity Q: What are the applications of
Pencillamine Disulphide Impurity | | CAS: | 113626-33-8 | | MF: | C10H20N2O4S2 | | MW: | 296.41 | | EINECS: | | | Product Categories: | | | Mol File: | 113626-33-8.mol |  |
| | L-PENICILLAMINE DISULFIDE (disulfide bond) Chemical Properties |
| Melting point | 207° | | alpha | D22 -26° (1N HCl) | | Boiling point | 467.0±45.0 °C(Predicted) | | density | 1.353±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Aqueous Base (Slightly), Water (Slightly, Heated) | | form | Solid | | pka | 1.76±0.12(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C10H20N2O4S2/c1-9(2,5(11)7(13)14)17-18-10(3,4)6(12)8(15)16/h5-6H,11-12H2,1-4H3,(H,13,14)(H,15,16)/t5-,6-/m1/s1 | | InChIKey | POYPKGFSZHXASD-PHDIDXHHSA-N | | SMILES | S(C(C)(C)[C@@H](C(O)=O)N)SC(C)(C)[C@@H](C(O)=O)N |
| | L-PENICILLAMINE DISULFIDE (disulfide bond) Usage And Synthesis |
| Uses | 3,3''-Dithiobis-L-valine is derived from L-Penicillamine (P223005), which is a metabolite of penicillin. L-Penicillamine is used in the treatment of Wilson’s disease, Cystinuria, Scleroderma and arsenic poisoning. |
| | L-PENICILLAMINE DISULFIDE (disulfide bond) Preparation Products And Raw materials |
|