|
|
| | 2-Propenoic acid ,2-methyl-,2-ethyldecahydro-1,4:5,8-dimethanonaphthalen-2-yl ester Basic information |
| Product Name: | 2-Propenoic acid ,2-methyl-,2-ethyldecahydro-1,4:5,8-dimethanonaphthalen-2-yl ester | | Synonyms: | 2-Propenoic acid ,2-methyl-,2-ethyldecahydro-1,4:5,8-dimethanonaphthalen-2-yl ester;ETCDMA 2-Propenoic acid ,2-methyl-,2-ethyldecahydro-1,4:5,8-dimethanonaphthalen-2-yl ester;2-Propenoic acid, 2-methyl-, 2-ethyldecahydro-1,4:5,8-dimethanonaphthalen-2-yl ester (9CI);2-ethyldecahydro-1,4:5,8-dimethanonaphthalen-2-yl methacrylate;ETCDMA | | CAS: | 485819-03-2 | | MF: | C18H26O2 | | MW: | 274.4 | | EINECS: | | | Product Categories: | | | Mol File: | 485819-03-2.mol |  |
| | 2-Propenoic acid ,2-methyl-,2-ethyldecahydro-1,4:5,8-dimethanonaphthalen-2-yl ester Chemical Properties |
| Boiling point | 351.1±11.0 °C(Predicted) | | density | 1.08±0.1 g/cm3(Predicted) | | InChI | InChI=1S/C18H26O2/c1-4-18(20-17(19)10(2)3)9-13-8-14(18)16-12-6-5-11(7-12)15(13)16/h11-16H,2,4-9H2,1,3H3 | | InChIKey | ITIFWHYHYVQOSC-UHFFFAOYSA-N | | SMILES | C(OC1(CC)CC2CC1C1C2C2CC1CC2)(=O)C(C)=C |
| | 2-Propenoic acid ,2-methyl-,2-ethyldecahydro-1,4:5,8-dimethanonaphthalen-2-yl ester Usage And Synthesis |
| | 2-Propenoic acid ,2-methyl-,2-ethyldecahydro-1,4:5,8-dimethanonaphthalen-2-yl ester Preparation Products And Raw materials |
|