Methyl-PEG24-Amine manufacturers
- m-PEG24-NH2
-
- $29.00
-
2026-05-11
- CAS:2151823-08-2
- Purity: ≥98%
- Supply Ability: 10g
- m-PEG24-NH2
-
- $2.00
-
2026-04-17
- CAS:2151823-08-2
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
- mPEG24-NH2
-
-
2026-01-28
- CAS:2151823-08-2
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 300kg
|
| | Methyl-PEG24-Amine Basic information |
| Product Name: | Methyl-PEG24-Amine | | Synonyms: | Methyl-PEG24-Amine;CAS_2151823-08-2;3,6,9,12,15,18,21,24,27,30,33,36,39,42,45,48,51,54,57,60,63,66,69,72-Tetracosaoxatriheptacontan-1-amine;Methly-PEG24-Amine;inhibit,mPEG24NH2,m-PEG-24-NH2,m PEG24 NH2,Inhibitor,PROTAC Linkers;mPEG24-NH2/3,6,9,12,15,18,21,24,27,30,33,36,39,42,45,48,51,54,57,60,63,66,69,72-Tetracosaoxatriheptacontan-1-amine;2,5,8,11,14,17,20,23,26,29,32,35,38,41,44,47,50,53,56,59,62,65,68,71-Tetracosaoxatriheptacontan-73-amine | | CAS: | 2151823-08-2 | | MF: | C49H101NO24 | | MW: | 0 | | EINECS: | | | Product Categories: | peg | | Mol File: | 2151823-08-2.mol |  |
| | Methyl-PEG24-Amine Chemical Properties |
| storage temp. | 2-8°C, protect from light | | form | powder to crystal | | color | White to Almost white | | InChIKey | OAYCKRSBSZUIGB-UHFFFAOYSA-N | | SMILES | C(N)COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOC |
| | Methyl-PEG24-Amine Usage And Synthesis |
| | Methyl-PEG24-Amine Preparation Products And Raw materials |
|