- Melamine cyanurate
-
- $0.00 / 25kg
-
2026-04-20
- CAS:37640-57-6
- Min. Order: 1kg
- Purity: ≥99.5%
- Supply Ability: 3000mt/year
- Melamine cyanurate
-
- $3.00 / 25KG
-
2026-04-17
- CAS:37640-57-6
- Min. Order: 0.1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | Melamine cyanurate Basic information |
| Product Name: | Melamine cyanurate | | Synonyms: | MELAMINE CYANURATE;1,3,5-triazine-2,4,6(1h,3h,5h)-trione,compd.with1,3,5-triazine-2,4,6-triam;1,3,5-triazine-2,4,6(1h,3h,5h)-trione,compd.with1,3,5-triazine-2,4,6-triamin;1,3,5-Triazine-2,4,6(1H,3H,5H)-trione,compd.with1,3,5-triazine-2,4,6-triamine(1:1);FR-MC;Melamine cyanurate (1:1);Melamine Cyanurate (MC);2,4,6-triamino-s-triazincompd.withs-triazine-triol | | CAS: | 37640-57-6 | | MF: | C6H9N9O3 | | MW: | 255.2 | | EINECS: | 253-575-7 | | Product Categories: | Flame retardant;MCA | | Mol File: | 37640-57-6.mol |  |
| | Melamine cyanurate Chemical Properties |
| Melting point | 350°C (dec.) | | density | 1.70 | | refractive index | 1.571 | | storage temp. | Refrigerator | | solubility | Acidic DMSO (Sparingly), Aqueous Acid (Slightly) | | form | Solid | | color | White to Off-White | | Odor | Slight odor | | Water Solubility | insoluble | | InChI | InChI=1S/C3H6N6.C3H3N3O3/c4-1-7-2(5)9-3(6)8-1;7-1-4-2(8)6-3(9)5-1/h(H6,4,5,6,7,8,9);(H3,4,5,6,7,8,9) | | InChIKey | ZQKXQUJXLSSJCH-UHFFFAOYSA-N | | SMILES | NC1=NC(N)=NC(N)=N1.O=C1NC(=O)NC(=O)N1 | | LogP | -2.28 at 25℃ | | CAS DataBase Reference | 37640-57-6(CAS DataBase Reference) | | EPA Substance Registry System | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, compd. with 1,3,5-triazine-2,4,6-triamine (1:1) (37640-57-6) |
| | Melamine cyanurate Usage And Synthesis |
| Chemical Properties | Melamine cyanurate is non-flammable and has very stable chemical properties. | | Uses | Environmental-friendly halogen-free inflaming lubricating agent | | Uses | Melamine Cyanurate is a crystalline complex formed between Melamine (M208700) and Cyanuric Acid (C987715), and is unique in that it is a halogen-free flame retardant. | | Definition | ChEBI: A crystalline complex formed from a 1:1 mixture of melamine and cyanuric (isocyanuric) acid, held together by an extensive two-dimensional network of hydrogen bonds between the two compounds. | | Application | Melamine cyanurate is particularly effective in improving fire safety of nitrogen-based polymers, such as polyamides (nylons) and thermoplastics (polyurethane). It can be used in epoxy polymers and in a variety of other substrates. | | Flammability and Explosibility | Not classified | | Synthesis | Melamine cyanurate is synthesised by reacting cyanuric acid and melamine in an aqueous medium in the presence of strong mineral acids. This reaction requires the presence of a strong inorganic acid (hydrochloric acid) at a pH not exceeding 1.
|
| | Melamine cyanurate Preparation Products And Raw materials |
|