5,10,15,20-tetrakis(4-ethynylphenyl)-21H,23H-Porphine manufacturers
|
| | 5,10,15,20-tetrakis(4-ethynylphenyl)-21H,23H-Porphine Basic information |
| Product Name: | 5,10,15,20-tetrakis(4-ethynylphenyl)-21H,23H-Porphine | | Synonyms: | 5,10,15,20-tetra(4-ethynylphenyl)porphyrin;5,10,15,20-tetrakis(4-ethynylphenyl)-21H,23H-Porphine;21H,23H-Porphine, 5,10,15,20-tetrakis(4-ethynylphenyl)- | | CAS: | 160240-15-3 | | MF: | C52H30N4 | | MW: | 710.82 | | EINECS: | | | Product Categories: | | | Mol File: | 160240-15-3.mol |  |
| | 5,10,15,20-tetrakis(4-ethynylphenyl)-21H,23H-Porphine Chemical Properties |
| density | 1.37±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | Appearance | Pale purple to purple Powder | | InChIKey | CWGZUDCLBKTFEM-RCOMQYLTSA-N | | SMILES | C1(C2=CC=C(C#C)C=C2)=C2N=C(C(C3=CC=C(C#C)C=C3)=C3NC(=C(C4=CC=C(C#C)C=C4)C4=NC(=C(C5=CC=C(C#C)C=C5)C5NC1=CC=5)C=C4)C=C3)C=C2 |c:22,t:9,25,38| |
| | 5,10,15,20-tetrakis(4-ethynylphenyl)-21H,23H-Porphine Usage And Synthesis |
| | 5,10,15,20-tetrakis(4-ethynylphenyl)-21H,23H-Porphine Preparation Products And Raw materials |
|