BIPHENYL-D10 manufacturers
- Biphenyl-d10
-
- $0.00 / 1mg
-
2026-01-04
- CAS:1486-01-7
- Min. Order:
- Purity:
- Supply Ability: 10g
|
| | BIPHENYL-D10 Basic information |
| Product Name: | BIPHENYL-D10 | | Synonyms: | 1,1'-Diphenyl D10;BIPHENYL-D10;DIPHENYL (D10);1,1’-biphenyl-d10;BIPHENYL-D10, 99 ATOM % D;BIPHENYL-D10 (D, 98%);1,2,3,4,5-pentadeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)benzene;D10-Biphenyl | | CAS: | 1486-01-7 | | MF: | C12D10 | | MW: | 164.27 | | EINECS: | | | Product Categories: | | | Mol File: | 1486-01-7.mol |  |
| | BIPHENYL-D10 Chemical Properties |
| Melting point | 70-72 °C (lit.) | | Boiling point | 255°/759.8mm | | density | 0.992 | | Fp | 110 °C | | Stability: | Stable. Combustible. | | Major Application | electronics | | InChI | InChI=1S/C12H10/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-10H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D | | InChIKey | ZUOUZKKEUPVFJK-LHNTUAQVSA-N | | SMILES | C1(=C([2H])C(=C([2H])C([2H])=C1[2H])[2H])C1C([2H])=C(C([2H])=C([2H])C=1[2H])[2H] | | CAS DataBase Reference | 1486-01-7 | | EPA Substance Registry System | Biphenyl-d12 (1486-01-7) | | CAS Number Unlabeled | 92-52-4 |
| Hazard Codes | Xi,N | | Risk Statements | 36/37/38-50/53 | | Safety Statements | 23-60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 2 | | HazardClass | 9 | | HS Code | 28459000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | BIPHENYL-D10 Usage And Synthesis |
| Chemical Properties | colourless crystals with a distinctive odour | | Uses | 1,1?-Diphenyl-D10 is a labelled analogue of 1,1?-Diphenyl . |
| | BIPHENYL-D10 Preparation Products And Raw materials |
|