|
|
| | Dibenzoyl-D-tartaric acid Basic information |
| | Dibenzoyl-D-tartaric acid Chemical Properties |
| Melting point | 154-156 °C(lit.) | | alpha | 120 º (c=5, MeOH) | | Boiling point | 450.75°C (rough estimate) | | density | 1.3806 (rough estimate) | | bulk density | 510kg/m3 | | refractive index | 1.5500 (estimate) | | storage temp. | Store below +30°C. | | solubility | Acetonitrile (Slightly), Ethanol (Slightly), Methanol (Slightly) | | pka | 1.85±0.25(Predicted) | | form | Powder | | color | White to yellow | | Optical Rotation | [α]28/D +116°, c = 9 in ethanol | | Water Solubility | insoluble | | Sensitive | Hygroscopic | | BRN | 2227343 | | InChI | 1S/C18H14O8/c19-15(20)13(25-17(23)11-7-3-1-4-8-11)14(16(21)22)26-18(24)12-9-5-2-6-10-12/h1-10,13-14H,(H,19,20)(H,21,22)/t13-,14-/m0/s1 | | InChIKey | YONLFQNRGZXBBF-KBPBESRZSA-N | | SMILES | OC(=O)[C@@H](OC(=O)c1ccccc1)[C@H](OC(=O)c2ccccc2)C(O)=O | | CAS DataBase Reference | 17026-42-5(CAS DataBase Reference) | | EPA Substance Registry System | Butanedioic acid, 2,3-bis(benzoyloxy)-, (2S,3S)- (17026-42-5) |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29181990 | | Storage Class | 11 - Combustible Solids |
| | Dibenzoyl-D-tartaric acid Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | (+)-Dibenzoyl-D-tartaric acid is a reagent used to produce chiral salts. | | Uses | For chiral resolution(+)-Dibenzoyl-D-tartaric acid is used as a reagent in the preparation of chiral salts. It also serves as a reagent for chiral resolution of amino compounds. | | Application | Dibenzoyl-D-tartaric acid, also known as (+)-Dibenzoyl-D-tartaric acid is a pharmaceutical intermediate compound used in the preparation of the anticancer drugs Sotorasib and Zanubrutinib. | | General Description | (+)-2,3-Dibenzoyl-D-tartaric acid is commonly used as an optically active resolving agent in the chiral resolution process such as diastereomeric salt resolution technique. |
| | Dibenzoyl-D-tartaric acid Preparation Products And Raw materials |
|