| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 1-Oxazolo[4,5-b]pyridin-2-yl-6-phenylhexan-1-one Basic information |
| | 1-Oxazolo[4,5-b]pyridin-2-yl-6-phenylhexan-1-one Chemical Properties |
| Boiling point | 460.8±47.0 °C(Predicted) | | density | 1.172±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; DMSO:PBS (pH 7.2)(1:2): .25 mg/ml; Ethanol: 10 mg/ml | | form | solid | | pka | -1.77±0.50(Predicted) | | InChI | 1S/2C18H18N2O2/c2*21-15(18-20-17-16(22-18)12-7-13-19-17)11-6-2-5-10-14-8-3-1-4-9-14/h2*1,3-4,7-9,12-13H,2,5-6,10-11H2 | | InChIKey | LFAKEBRRAYWLPI-UHFFFAOYSA-N | | SMILES | O=C(C1=NC2=C(C=CC=N2)O1)CCCCCC3=CC=CC=C3 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 1-Oxazolo[4,5-b]pyridin-2-yl-6-phenylhexan-1-one Usage And Synthesis |
| | 1-Oxazolo[4,5-b]pyridin-2-yl-6-phenylhexan-1-one Preparation Products And Raw materials |
|