- 2-Methoxy-5-nitrophenol
-
- $100.00 / 1KG
-
2025-09-25
- CAS:636-93-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 2-Methoxy-5-nitrophenol Basic information |
| | 2-Methoxy-5-nitrophenol Chemical Properties |
| Melting point | 103-107 °C (lit.) | | Boiling point | 110-112 °C/1 mmHg (lit.) | | density | 1.3375 (estimate) | | refractive index | 1.5830 (rough estimate) | | Fp | 110-112°C/1mm | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | pka | 8.31±0.19(Predicted) | | form | Solid | | color | Light Yellow to Light Brown | | BRN | 2047074 | | InChI | InChI=1S/C7H7NO4/c1-12-7-3-2-5(8(10)11)4-6(7)9/h2-4,9H,1H3 | | InChIKey | KXKCTSZYNCDFFG-UHFFFAOYSA-N | | SMILES | C1(O)=CC([N+]([O-])=O)=CC=C1OC | | CAS DataBase Reference | 636-93-1(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | RIDADR | 2811 | | WGK Germany | 3 | | Hazard Note | Irritant | | PackingGroup | III | | HS Code | 29095090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-Methoxy-5-nitrophenol Usage And Synthesis |
| Chemical Properties | Yellow to light brown powder | | Uses | 2-Methoxy-5-nitrophenol is used in the synthesis of potent VEGF and tyrosine kinase inhibitors. Also used in the synthesis of GABA analogues and phosphodiesterase inhibitors such as rolipram. | | Definition | ChEBI: 2-Methoxy-5-nitrophenol is a member of 3-nitrophenols. | | Synthesis Reference(s) | Chemical and Pharmaceutical Bulletin, 28, p. 1287, 1980 DOI: 10.1248/cpb.28.1287 | | General Description | 2-Methoxy-5-nitrophenol is the substitution photoproduct formed on irradiation of 2-chloro-4-nitroanisole at 25°C in aqueous NaOH. |
| | 2-Methoxy-5-nitrophenol Preparation Products And Raw materials |
|