|
|
| | 3,4-(Methylenedioxy)phenylacetonitrile Basic information |
| | 3,4-(Methylenedioxy)phenylacetonitrile Chemical Properties |
| Melting point | 43-45 °C(lit.) | | Boiling point | 135-140°C 5mm | | density | 1.270±0.06 g/cm3(Predicted) | | Fp | >230 °F | | storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystal | | color | White to Light yellow | | Water Solubility | Insoluble in water. | | BRN | 7739 | | Exposure limits | NIOSH: IDLH 25 mg/m3 | | InChI | InChI=1S/C9H7NO2/c10-4-3-7-1-2-8-9(5-7)12-6-11-8/h1-2,5H,3,6H2 | | InChIKey | ZQPBOYASBNAXOZ-UHFFFAOYSA-N | | SMILES | O1C2=CC=C(CC#N)C=C2OC1 | | CAS DataBase Reference | 4439-02-5(CAS DataBase Reference) | | NIST Chemistry Reference | 3,4-Methylenedioxyphenylacetonitrile(4439-02-5) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 36-36/37 | | RIDADR | 3439 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29329990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
| | 3,4-(Methylenedioxy)phenylacetonitrile Usage And Synthesis |
| Chemical Properties | Pale yellow low melting solid | | Uses | 3,4-(Methylenedioxy)phenylacetonitrile was used in synthesis of derrubone. It was used as standard to analyze the seized methamphetamine samples showing unique profiles of stable isotopic compositions by isotope ratio mass spectrometry. | | General Description | 3,4-(Methylenedioxy)phenylacetonitrile undergoes hydrolysis catalyzed by nitrilase ZmNIT2 enzyme from maize. |
| | 3,4-(Methylenedioxy)phenylacetonitrile Preparation Products And Raw materials |
|