|
|
| | 1,1'-Bis(diphenylphosphino)ferrocene-palladium(II)dichloride dichloromethane complex Basic information | | Reaction |
| Product Name: | 1,1'-Bis(diphenylphosphino)ferrocene-palladium(II)dichloride dichloromethane complex | | Synonyms: | DICHLORO[1,1'-BIS(DIPHENYLPHOSPHINO)FERROCENE]-PALLADIUM DICHLOROMETHANE ADDUCT;DICHLORO[1,1'-BIS(DIPHENYLPHOSPHINO)FERROCENE]PALLADIUM(II) DICHLOROMETHANE COMPLEX;1,1'-BIS(DIPHENYLPHOSPHINO)FERROCENEPALLADIUM(II) DICHLORIDE, DICHLOROMETHANE;[1,1'-BIS(DIPHENYLPHOSPHINO)FERROCENE]DICHLOROPALLADIUM(II), COMPLEX WITH DICHLOROMETHANE (1:1);1'1-Bis(diphenylphosphino)fewocene Palladium(Ⅱ)chloride dichloromethane chloride;1,1'-Bis(diphenylphosphino)ferrocene-palladium(II)dichloride dichlorome;1,1'-Bis(diphenylphosphiNA)ferrocene-palladiuM(II)dichloride dichloroMethane coMplex;DICHLORO[1,1'-BIS(DIPHENYLPHOSPHINO)FERROCENE]PALLADIUM(II) DICHLOROMETHA | | CAS: | 95464-05-4 | | MF: | C34H28Cl2FeP2Pd.CH2Cl2 | | MW: | 816.63 | | EINECS: | 619-128-9 | | Product Categories: | Pd;Catalysis and Inorganic Chemistry;Homogeneous Pd Catalysts;Palladium;OLED | | Mol File: | 95464-05-4.mol |  |
| | 1,1'-Bis(diphenylphosphino)ferrocene-palladium(II)dichloride dichloromethane complex Chemical Properties |
| Melting point | 275-280 °C(lit.) | | density | 1 g/cm3 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Powder | | color | orange-red | | Water Solubility | Insoluble in water. | | Stability: | Light Sensitive | | InChI | InChI=1S/2C17H11P.CH2Cl2.2ClH.Fe.Pd/c2*1-3-9-15(10-4-1)18(17-13-7-8-14-17)16-11-5-2-6-12-16;2-1-3;;;;/h2*1-6,9-12,18H;1H2;2*1H;;/q;;;;;+2;/p-2 | | InChIKey | VRMVBERIWPSLSJ-UHFFFAOYSA-L | | SMILES | C(Cl)Cl.[Cl-][Pd+2]1(P(C2C=CC=CC=2)(C2C=CC=CC=2)[C-]23C4=C5C6=C2[Fe+2]27893456C3C2=C7[C-]8(C9=3)P1(C1C=CC=CC=1)C1C=CC=CC=1)[Cl-] | | CAS DataBase Reference | 95464-05-4(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38-40-67-48/20/22 | | Safety Statements | 23-24/25-26-36/37 | | WGK Germany | 3 | | TSCA | No | | HS Code | 28439000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,1'-Bis(diphenylphosphino)ferrocene-palladium(II)dichloride dichloromethane complex Usage And Synthesis |
| Reaction |
- Catalyst for the borylation of aryl halides.
- β-Alkyl Suzuki-Miyaura cross-coupling reactions with potassium alkyltrifluoroborates.
- Catalyst for modified Negishi coupling.
- Synthesis of polyheterocycles by a Pd-catalyzed intramolecular N-arylation/C-H bond activation/aryl-aryl bond-forming domino process.
- Catalyst for Stille allylation.
- Catalyst for the amination of aryl bromides.

| | Chemical Properties | orange/red solid | | Uses | suzuki reaction | | Uses | 1,1'-Bis(diphenylphosphino)ferrocene-palladium(II)dichloride dichloromethane complex is used in the preparation of imidazoles, benzimidazoles, and tetrahydropyrimidines,it is also used as a catalyst for Suzuki and Stile couplings. | | Application | 1,1'-Bis(diphenylphosphino)ferrocene-palladium(II)dichloride dichloromethane complex is an organometallic compound that can be used as a noble metal catalyst for carbonylation reactions, cross-coupling reactions, Suzuki reaction. | | reaction suitability | core: palladium reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Cross Couplings reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: catalyst | | Synthesis | 1. Dissolve 2.00 grams of sodium palladium chloride in 30mL of anhydrous ethanol to obtain the ethanol solution of sodium palladium chloride; 2. Dissolve 4.15 grams of 1,1 '-bis (diphenylphosphine) ferrocene in 41mL dichloromethane to obtain 1,1' -bis (diphenylphosphine) ferrocene dichloromethane solution; 3. Under stirring conditions, add the ethanol solution of sodium palladite chloride in step 1 to dichloromethane solution of 1, 1 '-bis (diphenylphosphine) ferrocene in step 2. Stir and react for 1h at 25℃. 1,1'-Bis(diphenylphosphino)ferrocene-palladium(II)dichloride dichloromethane complex crystal, yield 90.46%. In this method, the target product 1,1'-Bis(diphenylphosphino)ferrocene-palladium(II)dichloride dichloromethane complex was synthesized directly with dichloromethane as the solvent in one step, eliminating the synthesis process of precursor PDCl2 (DPPF). The reaction process is simple, the synthesis cycle is short, easy to operate, and the purity of the synthesized product is 99.4%. |
| | 1,1'-Bis(diphenylphosphino)ferrocene-palladium(II)dichloride dichloromethane complex Preparation Products And Raw materials |
|