- BROMPERIDOL
-
- $20.00/ g
-
2026-02-11
- CAS:10457-90-6
- Min. Order: 0.0010000000474974513g
- Purity: 99%
- Supply Ability: 5000
- Bromperidol
-
- $35.00 / 10mg
-
2026-02-02
- CAS:10457-90-6
- Min. Order:
- Purity: 99.89%
- Supply Ability: 10g
- Bromperidol
-
- $35.00 / 10mg
-
2026-02-02
- CAS:10457-90-6
- Min. Order:
- Purity: 99.89%
- Supply Ability: 10g
|
| | BROMPERIDOL Basic information |
| Product Name: | BROMPERIDOL | | Synonyms: | R 11333;4-(4-(4-bromophenyl)-4-hydroxy-1-piperidinyl)-1-(4-fluorophenyl)-1-butanon;4-(4-(4-bromophenyl)-4-hydroxypiperidino)-4’-fluorobutyrophenone;4-(4-(p-bromophenyl)-4-hydroxypiperidino)-4’-fluoro-butyrophenon;4-(4-(p-bromophenyl)-4-hydroxypiperidino)-4’-fluorobutyrophenone;4-(4-(p-bromophenyl)-4-hydroxypiperidinol)-4’-fluorobutyrophenone;bromoperidol;4-[4-(4-BROMOPHENYL)-4-HYDROXY-1-PIPERIDINYL]-1-(4-FLUOROPHENYL)-1-BUTANONE | | CAS: | 10457-90-6 | | MF: | C21H23BrFNO2 | | MW: | 420.32 | | EINECS: | 233-943-3 | | Product Categories: | XEFO;Aromatics;Heterocycles;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 10457-90-6.mol |  |
| | BROMPERIDOL Chemical Properties |
| Melting point | 156-158°C | | Boiling point | 215.2°C (rough estimate) | | density | 1.3109 (estimate) | | storage temp. | Refrigerator | | solubility | H2O: insoluble | | pka | 8.6-8.7(at 25℃) | | form | solid | | color | white | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C21H23BrFNO2/c22-18-7-5-17(6-8-18)21(26)11-14-24(15-12-21)13-1-2-20(25)16-3-9-19(23)10-4-16/h3-10,26H,1-2,11-15H2 | | InChIKey | RKLNONIVDFXQRX-UHFFFAOYSA-N | | SMILES | BrC(C=C1)=CC=C1C(CC2)(O)CCN2CCCC(C3=CC=C(F)C=C3)=O | | CAS DataBase Reference | 10457-90-6(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | RTECS | EU1180000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral | | Toxicity | mouse,LD50,intraperitoneal,156mg/kg (156mg/kg),Iyakuhin Kenkyu. Study of Medical Supplies. Vol. 16, Pg. 1461, 1985. |
| | BROMPERIDOL Usage And Synthesis |
| Chemical Properties | Tan Solid | | Uses | Bromine analog of Haloperidol. Antipsychotic | | Uses | analgesic, antiinflammatory | | Definition | ChEBI: Bromperidol is an aromatic ketone. | | Biological Activity | Butyrophenone antipsychotic; D2 dopamine and 5-HT2A serotonin antagonist. | | in vivo | Bromperidol antagonises stereotyped behaviour and agitation induced by apomorphine or amphetamine, and inhibits conditioned reactions and learned intracranial self-stimulation in rats[1].
Bromperidol antagonises apomorphine-induced emesis and inhibits the conditioned avoidance response in dogs[1]. | | IC 50 | D2 Receptor |
| | BROMPERIDOL Preparation Products And Raw materials |
|