| Company Name: |
Hefei TNJ Chemical Industry Co.,Ltd. |
| Tel: |
+86-0551-65418671 +8618949823763 |
| Email: |
sales@tnjchem.com |
| Products Intro: |
Product Name:2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-ol CAS:307-30-2
|
|
|
|
|
|
| | 1H,1H-PENTADECAFLUORO-1-OCTANOL Basic information |
| Product Name: | 1H,1H-PENTADECAFLUORO-1-OCTANOL | | Synonyms: | 1H,1H-Perfluoro-1-octanol,98%;(Perfluorohept-1-yl)methanol, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Pentadecafluorooctan-1-ol;1H,1H-Pentadecafluorooctan-1-ol 98%;(Perfluoroheptyl)carbinol;1H,1H-Pentadecafluorooctan-1-ol98%;1H,1H-Pentadecafluoro-1-octanol;1H,1H-Perfluoro-1-octanol, 98% 5GR;DIHYDROPERFLUOROOCTANOL | | CAS: | 307-30-2 | | MF: | C8H3F15O | | MW: | 400.08 | | EINECS: | 206-197-1 | | Product Categories: | Fluorous Chemistry;Fluorous Compounds;Synthetic Organic Chemistry;Fluorous Synthesis;Rf-Tagged Building Blocks and Precursors;Specialty Synthesis | | Mol File: | 307-30-2.mol |  |
| | 1H,1H-PENTADECAFLUORO-1-OCTANOL Chemical Properties |
| Melting point | 44-47 °C(lit.) | | Boiling point | 163-165 °C(lit.) | | density | 1,338 g/cm3 | | refractive index | 1.3084 | | Fp | >110°C | | storage temp. | Store at room temperature | | solubility | almost transparency in Methanol | | form | Crystalline Mass | | pka | 12.86±0.10(Predicted) | | color | White | | BRN | 1716494 | | InChI | InChI=1S/C8H3F15O/c9-2(10,1-24)3(11,12)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)23/h24H,1H2 | | InChIKey | PJDOLCGOTSNFJM-UHFFFAOYSA-N | | SMILES | C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | CAS DataBase Reference | 307-30-2(CAS DataBase Reference) | | EPA Substance Registry System | 1-Octanol, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro- (307-30-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29055900 |
| | 1H,1H-PENTADECAFLUORO-1-OCTANOL Usage And Synthesis |
| Chemical Properties | white crystalline mass |
| | 1H,1H-PENTADECAFLUORO-1-OCTANOL Preparation Products And Raw materials |
|