|
|
| | Bis(2,4,6-trichlorophenyl)ethanedioate Basic information |
| Product Name: | Bis(2,4,6-trichlorophenyl)ethanedioate | | Synonyms: | 2,4,6-TRICHLOROPHENYL OXALATE;OXALIC ACID BIS(2,4,6-TRICHLOROPHENYL) ESTER;TCPO;TDPO;OXALIC ACID BIS(2 4 6-TRICHLOROPHENYL) &;Bis(2-Ethylhexyl)Sulfosuccinate,DocusateSodium;bis(2,4,6-trichlorphenyl)oxalate;Bis(2,4,6-trichlorophenyl) Oxalate [Chemiluminescence reagent for the determination of fluorescent compounds] | | CAS: | 1165-91-9 | | MF: | C14H4Cl6O4 | | MW: | 448.9 | | EINECS: | | | Product Categories: | Oxalates (Chemiluminescence);Analytical Chemistry;Chemiluminescence | | Mol File: | 1165-91-9.mol |  |
| | Bis(2,4,6-trichlorophenyl)ethanedioate Chemical Properties |
| Melting point | 188-192 °C | | Boiling point | 556.17°C (rough estimate) | | density | 1.698 | | refractive index | 1.5550 (estimate) | | Fp | 188-192°C | | storage temp. | Sealed in dry,Room Temperature | | solubility | almost transparency in hot Toluene | | form | Crystalline Powder | | color | White | | BRN | 2312135 | | InChI | InChI=1S/C14H4Cl6O4/c15-5-1-7(17)11(8(18)2-5)23-13(21)14(22)24-12-9(19)3-6(16)4-10(12)20/h1-4H | | InChIKey | GEVPIWPYWJZSPR-UHFFFAOYSA-N | | SMILES | C(OC1=C(Cl)C=C(Cl)C=C1Cl)(=O)C(OC1=C(Cl)C=C(Cl)C=C1Cl)=O | | CAS DataBase Reference | 1165-91-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-21/22 | | Safety Statements | 26-36-36/37/39 | | WGK Germany | 3 | | F | 8-10-21 | | HS Code | 29171190 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Bis(2,4,6-trichlorophenyl)ethanedioate Usage And Synthesis |
| Chemical Properties | WHITE CRYSTALLINE POWDER | | Uses | Reagent used for the generation of peroxy-oxalate chemiluminescence with H2O2. Used for the determination of fluorescent compounds in HPLC. | | Uses | Bis(2,4,6-trichlorophenyl)ethanedioate is a chemiluminescent chemical that is often used as a fluorescent dye. Bis(2,4,6-Trichlorophenyl)Oxalate is often used in chemiluminescent assays, in types of ELISA and for the detection of various particles, structure or compounds. |
| | Bis(2,4,6-trichlorophenyl)ethanedioate Preparation Products And Raw materials |
|