|
|
| | 2-(Bromomethyl)benzoic acid Basic information |
| | 2-(Bromomethyl)benzoic acid Chemical Properties |
| Melting point | 148-151°C | | Boiling point | 317.1±17.0 °C(Predicted) | | density | 1.635±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | pka | 3.66±0.36(Predicted) | | color | White | | Water Solubility | Insoluble in water. | | InChI | InChI=1S/C8H7BrO2/c9-5-6-3-1-2-4-7(6)8(10)11/h1-4H,5H2,(H,10,11) | | InChIKey | QSLMPDKYTNEMFQ-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC=C1CBr | | CAS DataBase Reference | 7115-89-1 |
| Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN3261 | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29163990 |
| | 2-(Bromomethyl)benzoic acid Usage And Synthesis |
| Chemical Properties | White solid | | Uses | 2-(Bromomethyl)benzoic acid contains bi functional groups such as benzylic bromide and carboxylic acid are involved in nucleophilic reactions and esterification reactions respectively. |
| | 2-(Bromomethyl)benzoic acid Preparation Products And Raw materials |
|