| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
OTAVA chemicals |
| Tel: |
416 305 9979 (Canada) |
| Email: |
north.america@otavachemicals.com |
|
| | 5-ethyl-5-(4-methoxy-3-methylphenyl)imidazolidine-2,4-dione Basic information |
| | 5-ethyl-5-(4-methoxy-3-methylphenyl)imidazolidine-2,4-dione Chemical Properties |
| density | 1.158±0.06 g/cm3(Predicted) | | pka | 8.63±0.10(Predicted) | | form | solid | | InChI | 1S/C13H16N2O3/c1-4-13(11(16)14-12(17)15-13)9-5-6-10(18-3)8(2)7-9/h5-7H,4H2,1-3H3,(H2,14,15,16,17) | | InChIKey | JCLBGUXDOASRGJ-UHFFFAOYSA-N | | SMILES | O=C(C1(CC)C(C=C2C)=CC=C2OC)NC(N1)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 5-ethyl-5-(4-methoxy-3-methylphenyl)imidazolidine-2,4-dione Usage And Synthesis |
| | 5-ethyl-5-(4-methoxy-3-methylphenyl)imidazolidine-2,4-dione Preparation Products And Raw materials |
|