|
|
| | 3-NITROPHENYL ISOCYANATE Basic information |
| | 3-NITROPHENYL ISOCYANATE Chemical Properties |
| Melting point | 51-52 °C(lit.) | | Boiling point | 130-131 °C11 mm Hg(lit.) | | density | 1.5018 (rough estimate) | | refractive index | 1.5300 (estimate) | | Fp | >230 °F | | storage temp. | 2-8°C | | form | Crystalline Solid | | color | Yellow | | Sensitive | Moisture Sensitive | | InChI | 1S/C7H4N2O3/c10-5-8-6-2-1-3-7(4-6)9(11)12/h1-4H | | InChIKey | GFFGYTMCNVMFAJ-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1cccc(c1)N=C=O | | CAS DataBase Reference | 3320-87-4(CAS DataBase Reference) | | EPA Substance Registry System | Benzene, 1-isocyanato-3-nitro- (3320-87-4) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38-42/43 | | Safety Statements | 22-26-36/37-45 | | RIDADR | 2206 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29291090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| | 3-NITROPHENYL ISOCYANATE Usage And Synthesis |
| Chemical Properties | yellow crystalline solid | | Uses | 3-Nitrophenyl isocyanate may be used in chemical synthesis studies. | | Purification Methods | Distil the isocyanate in a vacuum, and/or recrystallise it from pet ether (b 28-38o) or toluene/pet ether (m 52o). [Beilstein 12 H 708, 12 III 1573.] |
| | 3-NITROPHENYL ISOCYANATE Preparation Products And Raw materials |
|