|
|
| | 2,4-Difluorobenzylamine Basic information |
| Product Name: | 2,4-Difluorobenzylamine | | Synonyms: | RARECHEM AL BW 0282;2,4-DIFLUOROBENZYLAMINE;2,4-DIFLUOROBENZYLAMINE HYDROCHLORIDE;2,4-Difluorobenzylamine, 98+%;Benzenemethanamine, 2,4-difluoro-;2,4-Difluorobenzenemethanamine;2,4-Fluorobenzylamine;2,4-Difluorobenzylamine ,99% | | CAS: | 72235-52-0 | | MF: | C7H7F2N | | MW: | 143.13 | | EINECS: | 276-502-0 | | Product Categories: | Anilines, Aromatic Amines and Nitro Compounds;Amine;Amines;C7;Nitrogen Compounds;john's | | Mol File: | 72235-52-0.mol |  |
| | 2,4-Difluorobenzylamine Chemical Properties |
| Melting point | 255-256 °C(Solv: N,N-dimethylformamide (68-12-2)) | | Boiling point | 82-84 °C (15 mmHg) | | density | 1.204 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.49(lit.) | | Fp | 155 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 8.58±0.10(Predicted) | | form | Liquid | | color | Clear colorless to light yellow | | Specific Gravity | 1.204 | | Sensitive | Air Sensitive | | BRN | 3539259 | | InChI | InChI=1S/C7H7F2N/c8-6-2-1-5(4-10)7(9)3-6/h1-3H,4,10H2 | | InChIKey | QDZZDVQGBKTLHV-UHFFFAOYSA-N | | SMILES | C1(CN)=CC=C(F)C=C1F | | CAS DataBase Reference | 72235-52-0(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-27-36/37/39-45-25 | | RIDADR | UN 2735 8/PG 3 | | WGK Germany | 3 | | Hazard Note | Corrosive | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29214990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 2,4-Difluorobenzylamine Usage And Synthesis |
| Chemical Properties | clear colorless to light yellow liquid | | Uses | 2,4-Difluorobenzylamine has been used in the synthesis of βAla–Aib(N-fluoroarylmethyl)], nonpolar nucleobase dipeptide via Ugi four-component condensation reaction. |
| | 2,4-Difluorobenzylamine Preparation Products And Raw materials |
| Preparation Products | (4R,12aS)-N-(2,4-difluorobenzyl)-7-benzylhydroxy-4-Methyl-6,8-dioxo-3,4,6,8,12,12a-hexahydro-2H-pyrido[1',2':4,5]pyrazino[2,1-b][1,3]oxazine-9-carboxaMide-->O-Methyl Dolutegravir |
|