|
|
| | 5-AMINO-3-(4-METHYLPHENYL)PYRAZOLE Basic information |
| | 5-AMINO-3-(4-METHYLPHENYL)PYRAZOLE Chemical Properties |
| Melting point | 148-151 °C (lit.) | | Boiling point | 438.0±33.0 °C(Predicted) | | density | 1.196±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 14.80±0.10(Predicted) | | form | Powder | | color | White to off-white | | InChI | 1S/C10H11N3/c1-7-2-4-8(5-3-7)9-6-10(11)13-12-9/h2-6H,1H3,(H3,11,12,13) | | InChIKey | GVPFRVKDBZWRCZ-UHFFFAOYSA-N | | SMILES | Cc1ccc(cc1)-c2cc(N)[nH]n2 | | CAS DataBase Reference | 78597-54-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2933199090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 5-AMINO-3-(4-METHYLPHENYL)PYRAZOLE Usage And Synthesis |
| Uses | 5-Amino-3-(4-methylphenyl)pyrazole may be used:
- As a starting material for preparing 2,5-bis(4-methylphenyl)-7-phenyl-6,7-dihydropyrazolo[1,5-a]pyrimidine-3,6-dicarbaldehyde, a potential precursor for building bioactive fused polycyclic pyrazoles.
- To synthesize 4-hetarylpyrazolo[1,5-a][1,3,5]triazines under microwave conditions and in the absence of solvent.
- To synthesize 5-cyano-6,7-dihydro-3-(4-methylphenyl)-6-oxo-1H-pyrazolo[3,4-b]pyridine-4-carboxylates by reacting with dialkyl dicyanofumarates.
| | General Description | 5-Amino-3-(4-methylphenyl)pyrazole or 5-amino-3-(4-methylphenyl)-1H-pyrazole belongs to a family of 5-aminopyrazole derivatives, which are bioactive agents. They find a wide range of applications in the pharmaceutical and agrochemical industries. |
| | 5-AMINO-3-(4-METHYLPHENYL)PYRAZOLE Preparation Products And Raw materials |
|