- X-GAL
-
- $56.00 / 500mg
-
2026-02-25
- CAS:7240-90-6
- Min. Order:
- Purity: 99.42%
- Supply Ability: 10g
|
| | 5-Bromo-4-chloro-3-indolyl-beta-D-galactoside Basic information |
| | 5-Bromo-4-chloro-3-indolyl-beta-D-galactoside Chemical Properties |
| Melting point | 230 °C | | alpha | -64 º (C=1, H2O/DMF (1/1)) | | Boiling point | 673.9±55.0 °C(Predicted) | | density | 1.5563 (rough estimate) | | refractive index | 1.6110 (estimate) | | storage temp. | -20°C | | solubility | Soluble in 100 mM in DMSO. | | form | Powder | | pka | 12.74±0.70(Predicted) | | color | White | | Odor | Odorless | | Sensitive | Moisture & Light Sensitive | | Merck | 14,10074 | | BRN | 1402009 | | Stability: | Stable. Incompatible with strong oxidizing agents. | | InChI | 1S/C14H15BrClNO6/c15-5-1-2-6-9(10(5)16)7(3-17-6)22-14-13(21)12(20)11(19)8(4-18)23-14/h1-3,8,11-14,17-21H,4H2/t8-,11+,12+,13-,14-/m1/s1 | | InChIKey | OPIFSICVWOWJMJ-AEOCFKNESA-N | | SMILES | OC[C@H]1O[C@@H](Oc2c[nH]c3ccc(Br)c(Cl)c23)[C@H](O)[C@@H](O)[C@H]1O | | CAS DataBase Reference | 7240-90-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25-37/39-26 | | WGK Germany | 3 | | F | 8-10-21 | | HazardClass | IRRITANT | | HS Code | 29389090 | | Storage Class | 11 - Combustible Solids |
| | 5-Bromo-4-chloro-3-indolyl-beta-D-galactoside Usage And Synthesis |
| Chemical Properties | White Powder | | Uses | A substrate for β-Galactosidase that is converted by the enzyme into an intense indigo-blue chromophore (615 nm). | | Uses | magenta b-galactosidase substrate | | Uses | In histochemical staining, in blue-white selection of bacterial colonies with lacZ gene activity during cloning experiments. | | Uses | A substrate for -Galactosidase that is converted by the enzyme into an intense indigo-blue chromophore (615 nm) | | Definition | ChEBI: An indolyl carbohydrate that is the beta-D-galactoside of 3-hydroxy-1H-indole in which the indole moiety is substituted at positions 4 and 5 by chlorine and bromine, respectively. It is used to test for
he presence of an enzyme, beta-galactosidase, which cleaved the glycosidic bond to give 5-bromo-4-chloro-3-hydroxy-1H-indole, which immediately dimerises to give an intensely blue product. | | Biological Activity | X-gal is routinely used to detect transgene activity in situ. | | storage | +4°C |
| | 5-Bromo-4-chloro-3-indolyl-beta-D-galactoside Preparation Products And Raw materials |
|