| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | Poly(3,3',4,4'-biphenyltetracarboxylic dianhydride-co-1,4-phenylenediamine),amic acid Basic information |
| Product Name: | Poly(3,3',4,4'-biphenyltetracarboxylic dianhydride-co-1,4-phenylenediamine),amic acid | | Synonyms: | [5,5’-Biisobenzofuran]-1,1’,3,3’-tetrone,polymerwith1,4-benzenediamine;[5,5’-biisobenzofuran]-1,1’3,3’-tetrone,polymerwith1,4-benzenediamine;poly(biphenyltetracarboxylicdianhydride-co-pheny;Poly(3,3,4,4-biphenyltetracarboxylic dianhydride-co-1,4-phenylenediamine), amic acid (solution);BIPHENYL DIANHYDRIDE-P-PHENYLENEDIAMINE COPOLYMER;4,4'-biphthalic anhydride/ p-phenylenediamine copolymer;POLY(BIPHENYLTETRACARBOXYLIC DIANHYDRIDE- CO-PHENYLENEDIAMINE), AMIC ACID (SOLN);Poly(3,3',4,4'-biphenyltetracarboxylic dianhydride-co-1,4-phenylenediamine), amic acid solution 9.5-11.5 wt. % in 1-methyl-2-pyrrolidinone, electronic grade | | CAS: | 29319-22-0 | | MF: | C22H14N2O6 | | MW: | 402.36 | | EINECS: | | | Product Categories: | Amides and Imides;Hydrophobic Polymers;Polymer Science;Amides and Imides;Hydrophobic Polymers;Materials Science;Polymer Science;Polymers | | Mol File: | 29319-22-0.mol |  |
| | Poly(3,3',4,4'-biphenyltetracarboxylic dianhydride-co-1,4-phenylenediamine),amic acid Chemical Properties |
| Boiling point | 202 °C | | density | 1.07 g/mL at 25 °C | | refractive index | n20/D 1.497 | | Fp | 194 °F | | storage temp. | -20°C | | InChI | 1S/C16H6O6.C6H8N2/c17-13-9-3-1-7(5-11(9)15(19)21-13)8-2-4-10-12(6-8)16(20)22-14(10)18;7-5-1-2-6(8)4-3-5/h1-6H;1-4H,7-8H2 | | InChIKey | MUHWTMKSDCXLLV-UHFFFAOYSA-N | | SMILES | Nc5ccc(cc5)N.O1C(=O)c2c(ccc(c2)c3cc4c(cc3)C(=O)OC4=O)C1=O | | EPA Substance Registry System | [5,5'-Biisobenzofuran]-1,1',3,3'-tetrone, polymer with 1,4-benzenediamine (29319-22-0) |
| Hazard Codes | Xn,T | | Risk Statements | 20/21/22-36/37/38-43-63-61 | | Safety Statements | 23-26-36-36/37/39-45-53 | | RIDADR | NA 1993 / PGIII | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Eye Irrit. 2
Repr. 1B
Skin Irrit. 2
STOT SE 3 |
| | Poly(3,3',4,4'-biphenyltetracarboxylic dianhydride-co-1,4-phenylenediamine),amic acid Usage And Synthesis |
| Uses | Semi-conductor material. Dielectric component in thin films, high density interconnect systems and multichip modules. |
| | Poly(3,3',4,4'-biphenyltetracarboxylic dianhydride-co-1,4-phenylenediamine),amic acid Preparation Products And Raw materials |
|