| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Potassium hexahydroxoantimonate(V) Basic information |
| | Potassium hexahydroxoantimonate(V) Chemical Properties |
| Melting point | 240 °C (dec.)(lit.) | | density | 3.27[at 20℃] | | bulk density | 1200kg/m3 | | storage temp. | Store at +5°C to +30°C. | | solubility | 20g/l | | form | Powder | | color | White | | PH | 7.5-9.0 (20g/l, H2O, 20℃) | | Water Solubility | Soluble in water and glycerine. Insoluble in ethanol. | | Exposure limits | ACGIH: TWA 0.5 mg/m3 NIOSH: IDLH 50 mg/m3; TWA 0.5 mg/m3 | | InChI | InChI=1S/K.6O.Sb/q+1;6*-1;+5 | | InChIKey | RYPGMFDNBQLUIQ-UHFFFAOYSA-N | | SMILES | [Sb+5]([O-])([O-])([O-])([O-])([O-])[O-].[K+] | | CAS DataBase Reference | 12208-13-8(CAS DataBase Reference) | | EPA Substance Registry System | Antimonate (Sb(OH)61-), potassium, (OC-6-11)- (12208-13-8) |
| Hazard Codes | Xn,N | | Risk Statements | 20/22-51/53 | | Safety Statements | 61 | | RIDADR | UN 1549 6.1/PG 3 | | WGK Germany | 2 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 28419000 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Chronic 2 |
| | Potassium hexahydroxoantimonate(V) Usage And Synthesis |
| Uses | Potassium antimonyl trihydrate is used as a detecting agent for sodium. It is used as a mordant/ fixing agent in leather and textile dying industries. It is also used as a analytical reagent and flux additive for electroplating. | | Preparation | Heating antimony pentoxide with excess potassium hydroxide produces rubbery, granular, or crystalline products. If the substance is recrystallized from a little water, deliquescent mammilated crystals form. Treated with copious cold water or boiled together with a small quantity of water, they are converted into potassium hexahydroxyantimonate, K[Sb(OH)6], which is sparingly soluble in cold water but somewhat more soluble in warm water. Solutions precipitate sodium as the sparingly soluble sodium hexahydroxyantimonate, Na[Sb(OH)6]. This reaction is used for the detection of sodium.
|
| | Potassium hexahydroxoantimonate(V) Preparation Products And Raw materials |
|