|
|
| | Boc-4-Amino-L-phenylalanine Basic information |
| | Boc-4-Amino-L-phenylalanine Chemical Properties |
| Melting point | 124-126℃ | | Boiling point | 484.9±40.0 °C(Predicted) | | density | 1.213±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 3.74±0.10(Predicted) | | form | Powder | | color | White to off-white | | Optical Rotation | 25.6°(C=0.01g/mL, MEOH, 20°C, 589nm) | | Major Application | peptide synthesis | | InChI | 1S/C14H20N2O4/c1-14(2,3)20-13(19)16-11(12(17)18)8-9-4-6-10(15)7-5-9/h4-7,11H,8,15H2,1-3H3,(H,16,19)(H,17,18)/t11-/m0/s1 | | InChIKey | NDMVQEZKACRLDP-NSHDSACASA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(N)cc1)C(O)=O | | CAS DataBase Reference | 55533-24-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-28 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 13 - Non Combustible Solids |
| | Boc-4-Amino-L-phenylalanine Usage And Synthesis |
| Chemical Properties | White to off white powder | | Uses | Boc-4-Amino-L-phenylalanine is an intermediate used in the synthesis of biotinylated amino acids. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Boc-4-Amino-L-phenylalanine Preparation Products And Raw materials |
|