3-amino-5-(4-benzylphenyl)thieno[2,3-d]pyrimidin-4(3H)-one manufacturers
- Barbadin
-
- $44.00
-
2026-08-08
- CAS:356568-70-2
- Purity: 99.10%
- Supply Ability: 10g
- Barbadin
-
- $44.00
-
2026-08-08
- CAS:356568-70-2
- Purity: 99.10%
- Supply Ability: 10g
- Barbadin
-
- $44.00
-
2025-12-22
- CAS:356568-70-2
- Purity: 99.10%
- Supply Ability: 10g
|
| | 3-amino-5-(4-benzylphenyl)thieno[2,3-d]pyrimidin-4(3H)-one Basic information |
| | 3-amino-5-(4-benzylphenyl)thieno[2,3-d]pyrimidin-4(3H)-one Chemical Properties |
| Melting point | 175-180°C | | Boiling point | 539.8±60.0 °C(Predicted) | | density | 1.34±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Acetonitrile (Slightly), Chloroform (Slightly), DMSO (Slightly) | | pka | -1.88±0.20(Predicted) | | form | Solid | | color | White to Pale Yellow | | InChI | 1S/C19H15N3OS/c20-22-12-21-18-17(19(22)23)16(11-24-18)15-8-6-14(7-9-15)10-13-4-2-1-3-5-13/h1-9,11-12H,10,20H2 | | InChIKey | OCBXPCSXEQQADU-UHFFFAOYSA-N | | SMILES | O=C1N(C=NC2=C1C(C3=CC=C(C=C3)CC4=CC=CC=C4)=CS2)N |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 3-amino-5-(4-benzylphenyl)thieno[2,3-d]pyrimidin-4(3H)-one Usage And Synthesis |
| Uses | Barbadin is a selective β-arrestin/β2-adaptin inhibitor. It selectively inhibits the interaction between b-arrestin and the b2-adaptin subunit of the clathrin adaptor protein AP2 without affecting the formation of receptor/b-arrestin complexes. | | Biological Activity | selective b-arrestin/b2-adaptin inhibitor |
| | 3-amino-5-(4-benzylphenyl)thieno[2,3-d]pyrimidin-4(3H)-one Preparation Products And Raw materials |
|