|
|
| | Rhodium(III) 2,4-pentanedionate Basic information |
| Product Name: | Rhodium(III) 2,4-pentanedionate | | Synonyms: | 4-pentanedionato-o,o’)-tris((oc-6-11)-rhodiu;Rhodium acetylacetonate;Rhodium tris(acetylacetonate);Rhodium, tris(2,4-pentanedionato)-;Rhodium, tris(2,4-pentanedionato-O,O')-, (OC-6-11)-;Tris(2,4-pentanedionato)rhodium;Tris(acetylacetonato)rhodium;RhodiuM(III) acetylacetonate,98% Rh(CH3COCHCOCH3)3 | | CAS: | 14284-92-5 | | MF: | C15H21O6Rh | | MW: | 400.23 | | EINECS: | 238-192-5 | | Product Categories: | Rh;metal beta-diketonate complexes | | Mol File: | 14284-92-5.mol |  |
| | Rhodium(III) 2,4-pentanedionate Chemical Properties |
| Melting point | 263-264 °C(lit.) | | Boiling point | >280°C | | storage temp. | Inert atmosphere,Room Temperature | | form | Powder | | color | Yellow to yellow-orange | | Specific Gravity | 1.607 | | Water Solubility | insoluble | | Exposure limits | ACGIH: TWA 1 mg/m3
NIOSH: IDLH 100 mg/m3; TWA 0.1 mg/m3 | | InChI | InChI=1S/3C5H8O2.Rh/c3*1-4(6)3-5(2)7;/h3*3,6H,1-2H3;/q;;;+3/p-3/b3*4-3+; | | InChIKey | DGOINFUDFBWCMX-MUCWUPSWSA-K | | SMILES | [Rh](O/C(/C)=C/C(=O)C)(O/C(/C)=C/C(=O)C)O/C(/C)=C/C(=O)C | | CAS DataBase Reference | 14284-92-5 | | NIST Chemistry Reference | Rhodium, tris(2,4-pentanedionato-o,o')-(14284-92-5) | | EPA Substance Registry System | Rhodium, tris(2,4-pentanedionato-.kappa.O,.kappa.O')-, (OC-6-11)- (14284-92-5) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38-40-63 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 28439000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Repr. 2
Skin Irrit. 2
STOT SE 3 |
| | Rhodium(III) 2,4-pentanedionate Usage And Synthesis |
| Chemical Properties | Yellow/Orange Crystals | | Uses | Rhodium(III) 2,4-pentanedionate is used in catalytic reagents for organic synthesis. Rhodium(III) 2,4-pentanedionate is useful for hydrosilylation of a variety of organic substrates like alkenes, terminal or internal acetylenes, conjugated dienes, alpha, beta -unsaturated aldehydes and allylic compounds. It performs the role of a catalyst in well-known reactions such as transformation processes including hydrogenation, ethanol steam reforming, CO oxidation, and NOx reduction. Rhodium acetylacetonate, as the organic solvent-soluble source of rhodium metal ions, can be used to prepare monodisperse size/shape controlled Rh nanocrystals. Rh nanocrystal monolayers have been reported to show high activity for hydrogenation of vinylcyclohexene to selectively produce ethylcyclohexene. The size/shape controlled nanocrystals find a variety of applications in oil refining processes, chemical synthesis and fuel cell technology. | | Uses | Very effective catalyst for the hydrogenation of carboxylic acids when combined with group 6 or group 7 metal carbonyls. | | reaction suitability | reagent type: catalyst |
| | Rhodium(III) 2,4-pentanedionate Preparation Products And Raw materials |
|