- N-Ethyl-D-glucamine
-
- $0.00 / 25KG
-
2026-03-06
- CAS:14216-22-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100 MT
- N-Ethyl-D-glucamine
-
- $1.10 / 1g
-
2025-11-18
- CAS:14216-22-9
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons Min
|
| | N-Ethyl-D-glucamine Basic information |
| Product Name: | N-Ethyl-D-glucamine | | Synonyms: | N-ETHYLGLUCAMINE;N-ETHYL-D-GLUCAMINE;N-ethylgucamine;N-ETHYLGUCAMINE 99+%;1-(Ethylamino)-1-deoxy-D-glucitol;1-Ethylamino-1-deoxy-D-glucitol;(2R,3R,4R,5S)-6-(ethylamino)hexane-1,2,3,4,5-pentol;(2R,3R,4R,5S)-6-(EthylaMino)hexane-1,2,3,4,5-pentaol | | CAS: | 14216-22-9 | | MF: | C8H19NO5 | | MW: | 209.24 | | EINECS: | 238-073-8 | | Product Categories: | INORGANIC & ORGANIC CHEMICALS;Carbohydrate Synthesis;Monosaccharides;Specialty Synthesis | | Mol File: | 14216-22-9.mol |  |
| | N-Ethyl-D-glucamine Chemical Properties |
| Melting point | 136-140 °C | | alpha | -17 º (c=1%, H2O) | | Boiling point | 489.8±45.0 °C(Predicted) | | density | 1.320±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | H2O: 0.1 g/mL, clear, colorless | | pka | 13.51±0.20(Predicted) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]/D 17.0±2.0°, c = 1% in H2O | | Water Solubility | H2O: 0.1g/mL, clear to almost clear, colorless to very faintly yellow | | Stability: | Hygroscopic | | InChI | InChI=1S/C8H19NO5/c1-2-9-3-5(11)7(13)8(14)6(12)4-10/h5-14H,2-4H2,1H3/t5-,6+,7+,8+/m0/s1 | | InChIKey | IKXCHOUDIPZROZ-LXGUWJNJSA-N | | SMILES | C(NCC)[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O | | CAS DataBase Reference | 14216-22-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-24/25 | | WGK Germany | 3 | | F | 3-10-23 | | HS Code | 29221990 | | Storage Class | 11 - Combustible Solids |
| | N-Ethyl-D-glucamine Usage And Synthesis |
| Chemical Properties | Colorless powder | | Uses | N-Ethyl-D-glucamine is an ethylated amino sugar derived from Glucose (G595000). It has low vapor pressure and good thermal stability in air, and is used in self-driven microfluidic method to pattern organic films directly in air. |
| | N-Ethyl-D-glucamine Preparation Products And Raw materials |
|