- 3-Bromophenylalanine
-
- $2.20 / 100kg
-
2025-10-13
- CAS:30163-20-3
- Min. Order: 1kg
- Purity: 99%min
- Supply Ability: 100kg
|
| | 2-AMINO-3-(3-BROMO-PHENYL)-PROPIONIC ACID Basic information |
| | 2-AMINO-3-(3-BROMO-PHENYL)-PROPIONIC ACID Chemical Properties |
| Boiling point | 368.4±32.0 °C(Predicted) | | density | 1.588±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Aqueous Acid (Slightly), Aqueous Base (Slightly), Methanol (Slightly, Heated) | | form | Solid | | pka | 2.16±0.10(Predicted) | | color | White to off-white | | Optical Rotation | 0.233°(C=0.01g/ml MEOH) | | InChI | InChI=1S/C9H10BrNO2/c10-7-3-1-2-6(4-7)5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13)/t8-/m0/s1 | | InChIKey | GDMOHOYNMWWBAU-QMMMGPOBSA-N | | SMILES | C(O)(=O)[C@H](CC1=CC=CC(Br)=C1)N |
| | 2-AMINO-3-(3-BROMO-PHENYL)-PROPIONIC ACID Usage And Synthesis |
| Uses | DL-3-Bromophenylalanine is used in the synthetic preparation of hydroxyethylene sulfones as scaffolds for design, synthesis, and structural characterization of aspartic proteinase inhibitors. |
| | 2-AMINO-3-(3-BROMO-PHENYL)-PROPIONIC ACID Preparation Products And Raw materials |
|