|
|
| | 3-Bromo-2-nitrophenol Basic information |
| Product Name: | 3-Bromo-2-nitrophenol | | Synonyms: | 3-Bromo-2-nitrophenol 99%;2-Bromo-6-hydroxynitrobenzene;3-Bromo-2-nitrophenol96%;Phenol, 3-bromo-2-nitro-;3-BROMO-2-NITROPHENOL;2-Nitro-3-bromophenol | | CAS: | 76361-99-4 | | MF: | C6H4BrNO3 | | MW: | 218 | | EINECS: | | | Product Categories: | | | Mol File: | 76361-99-4.mol |  |
| | 3-Bromo-2-nitrophenol Chemical Properties |
| Melting point | 65-67 °C | | Boiling point | 134-136 °C(Press: 12 Torr) | | density | 1.881±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | crystalline solid | | pka | 4.49±0.10(Predicted) | | color | Yellow | | InChI | InChI=1S/C6H4BrNO3/c7-4-2-1-3-5(9)6(4)8(10)11/h1-3,9H | | InChIKey | AUORDBJGOHYGKR-UHFFFAOYSA-N | | SMILES | C1(O)=CC=CC(Br)=C1[N+]([O-])=O |
| | 3-Bromo-2-nitrophenol Usage And Synthesis |
| Chemical Properties | Light yellow crystalline |
| | 3-Bromo-2-nitrophenol Preparation Products And Raw materials |
|