- 2-BROMO-6-FLUOROANILINE
-
- $0.00 / 25KG
-
2025-12-01
- CAS:65896-11-9
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 10000KGS
- 2-Bromo-6-fluoroaniline
-
- $0.00 / 1kg
-
2025-06-04
- CAS:65896-11-9
- Min. Order: 1kg
- Purity: 99%+
- Supply Ability: 10000kgs per Month
|
| | 2-BROMO-6-FLUOROANILINE Basic information |
| | 2-BROMO-6-FLUOROANILINE Chemical Properties |
| Boiling point | 211.0±20.0 °C(Predicted) | | density | 1.674 g/mL at 20 °C (lit.) | | refractive index | n20/D 1.582(lit.) | | Fp | 82° | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform, Ethyl Acetate | | pka | 1.15±0.10(Predicted) | | form | Liquid | | color | Clear yellow to brown | | BRN | 8541957 | | InChI | InChI=1S/C6H5BrFN/c7-4-2-1-3-5(8)6(4)9/h1-3H,9H2 | | InChIKey | ALZFPYUPNVLVQM-UHFFFAOYSA-N | | SMILES | C1(N)=C(F)C=CC=C1Br | | CAS DataBase Reference | 65896-11-9(CAS DataBase Reference) |
| Hazard Codes | Xi,T | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN2810 | | WGK Germany | 3 | | Hazard Note | Toxic | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29214200 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-BROMO-6-FLUOROANILINE Usage And Synthesis |
| Chemical Properties | Clear yellow to brown liquid | | Uses | 2-BroMo-6-fluoroaniline is used for preparation of cycloalkylated benzothiadiazine derivatives and their use as AMPA receptor modulators. |
| | 2-BROMO-6-FLUOROANILINE Preparation Products And Raw materials |
|