|
|
| | 4-(Hydroxymethyl)benzoic acid Basic information |
| | 4-(Hydroxymethyl)benzoic acid Chemical Properties |
| Melting point | 182-185 °C (lit.) | | Boiling point | 140-150 °C(Press: 9 Torr) | | density | 1.314±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO, Methanol | | form | Coarse Fibers | | pka | 4.16±0.10(Predicted) | | color | White | | BRN | 2690023 | | InChI | InChI=1S/C8H8O3/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4,9H,5H2,(H,10,11) | | InChIKey | WWYFPDXEIFBNKE-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(CO)C=C1 | | LogP | 0.930 | | CAS DataBase Reference | 3006-96-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | HS Code | 29181990 | | Storage Class | 11 - Combustible Solids |
| | 4-(Hydroxymethyl)benzoic acid Usage And Synthesis |
| Chemical Properties | Off-white solid | | Uses | 4-(Hydroxymethyl)benzoic Acid is an intermediate in the synthesis of Eprosartan (E590100), a prototype of the imidazoleacrylic acid angiotensin II receptor antagonists used as an antihypertensive age
nt. | | Uses | This linkage reagent for SPPS is essentially acid stable. It is useful in combination with Fmoc-amino acids. Its peptide esters are usually cleaved by basic or nucleophilic reagents, especially by ammonia in the preparation of peptide amides. | | Uses | 4-(Hydroxymethyl)benzoic Acid (Eprosartan USP Related Compound E) is an intermediate in the synthesis of Eprosartan (E590100), a prototype of the imidazoleacrylic acid angiotensin II receptor antagonists used as an antihypertensive agent. | | Synthesis Reference(s) | Journal of the American Chemical Society, 107, p. 1365, 1985 DOI: 10.1021/ja00291a042 | | reaction suitability | reagent type: linker |
| | 4-(Hydroxymethyl)benzoic acid Preparation Products And Raw materials |
|