| Company Name: |
Bide Pharmatech Ltd.
|
| Tel: |
400-1647117 13681763483 |
| Email: |
product02@bidepharm.com |
| Products Intro: |
Product Name:(4-(4-Chlorophenyl)thiazol-2-yl)methanol
CAS:287198-05-4
Purity:97% Package:100mg;250mg;1g Remarks:BD624529
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:(4-(4-Chlorophenyl)thiazol-2-yl)methanol
CAS:287198-05-4
|
| Company Name: |
Aikon International Limited
|
| Tel: |
025-58859352 18651614124 |
| Email: |
2881516338@qq.com |
| Products Intro: |
CAS:287198-05-4
Purity:95%+ Package:1g;5g;10g
|
| Company Name: |
Hebei Yaocheng Pharmaceutical Technology Co. Ltd
|
| Tel: |
18033875090 |
| Email: |
yc-eliu@yaochengph.com |
| Products Intro: |
Product Name:4-(4-chloro-phenyl)-thiazol-2-yl]-methanol
CAS:287198-05-4
Purity:95% Package:5g; 10g; 25g; 100g; 250g; 500g; 1kg
|
| Company Name: |
Heterocyclics Inc
|
| Tel: |
732-444-6336 |
| Email: |
info@heterocyclics.com |
| Products Intro: |
Product Name:JR-14112, (4-(4-Chlorophenyl)thiazol-2-yl)methanol, 97%
CAS:287198-05-4
|
|
| | [4-(4-chlorophenyl)-1,3-thiazol-2-yl]methanol Basic information |
| | [4-(4-chlorophenyl)-1,3-thiazol-2-yl]methanol Chemical Properties |
| form | solid | | InChI | 1S/C10H8ClNOS/c11-8-3-1-7(2-4-8)9-6-14-10(5-13)12-9/h1-4,6,13H,5H2 | | InChIKey | UICGABWUJKMBEN-UHFFFAOYSA-N | | SMILES | ClC1=CC=C(C=C1)C2=CSC(CO)=N2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1 |
| | [4-(4-chlorophenyl)-1,3-thiazol-2-yl]methanol Usage And Synthesis |
| | [4-(4-chlorophenyl)-1,3-thiazol-2-yl]methanol Preparation Products And Raw materials |
|