|
|
| | 4'-Chloro-3'-nitroacetophenone Basic information |
| | 4'-Chloro-3'-nitroacetophenone Chemical Properties |
| Melting point | 99-101 °C(lit.) | | Boiling point | 160°C (rough estimate) | | density | 1.4125 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | Store at room temperature | | form | powder to crystal | | color | White to Light yellow to Green | | BRN | 1640627 | | InChI | 1S/C8H6ClNO3/c1-5(11)6-2-3-7(9)8(4-6)10(12)13/h2-4H,1H3 | | InChIKey | YEVPHFIFGUWSMG-UHFFFAOYSA-N | | SMILES | CC(=O)c1ccc(Cl)c(c1)[N+]([O-])=O | | CAS DataBase Reference | 5465-65-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29147000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4'-Chloro-3'-nitroacetophenone Usage And Synthesis |
| Chemical Properties | light yellow powder | | Uses | 4′-Chloro-3′-nitroacetophenone was used to prepare starting reagent for the synthesis of 6- and 7-acetyl-3-methyl-2-quinoxalinecarboxamide1,4-dioxides. | | General Description | 4′-Chloro-3′-nitroacetophenone is the intermediate formed during the synthesis of 4-chloro-3-nitrostyrene. It participates in deamination reaction of 4-chloro-5- and -3-nitro-2-aminoacetophanones. |
| | 4'-Chloro-3'-nitroacetophenone Preparation Products And Raw materials |
|