5-ACETYLSALICYLIC ACID manufacturers
|
| | 5-ACETYLSALICYLIC ACID Basic information |
| | 5-ACETYLSALICYLIC ACID Chemical Properties |
| Melting point | 214-216°C | | Boiling point | 413.0±35.0 °C(Predicted) | | density | 1.365±0.06 g/cm3(Predicted) | | Fp | 250°C | | storage temp. | 2-8°C | | solubility | Soluble in DMSO | | form | powder to crystalline | | pka | 2.62±0.10(Predicted) | | color | White to Light yellow | | Sensitive | Moisture Sensitive | | BRN | 2096968 | | InChI | InChI=1S/C9H8O4/c1-5(10)6-2-3-8(11)7(4-6)9(12)13/h2-4,11H,1H3,(H,12,13) | | InChIKey | NZRDKNBIPVLNHA-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(C(C)=O)=CC=C1O | | CAS DataBase Reference | 13110-96-8(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 22 | | HS Code | 2918.29.7500 |
| Provider | Language |
|
ALFA
| English |
| | 5-ACETYLSALICYLIC ACID Usage And Synthesis |
| Uses | 5-acetylsalicylic acid (cas# 13110-96-8) is a useful research chemical. It is used in radiation-sensitive resin composition, method of forming a pattern, and method for production of monomeric compound. | | Preparation | Obtained by Fries rearrangement of 2-(acetyloxy)-benzoic acid (Aspirin) (1 mol) in the presence of aluminium chloride (3.3 mol),
in nitrobenzene at r.t. for 1 h (36%) ;
without solvent at 120–125° for 1 h (19%). | | Definition | ChEBI: 5-Acetylsalicylic acid is an aromatic ketone. | | Synthesis Reference(s) | Journal of Medicinal Chemistry, 23, p. 738, 1980 DOI: 10.1021/jm00181a008 |
| | 5-ACETYLSALICYLIC ACID Preparation Products And Raw materials |
|