- BES-NA
-
- $0.00 / 25Kg/Drum
-
2025-12-17
- CAS:66992-27-6
- Min. Order: 1KG
- Purity: 99%min
- Supply Ability: 500kgs
|
| | N,N-Bis(2-hydroxyethyl)-2-aminoethanesulfonic acid sodium salt Basic information |
| Product Name: | N,N-Bis(2-hydroxyethyl)-2-aminoethanesulfonic acid sodium salt | | Synonyms: | N,N-BIS(2-HYDROXYETHYL)-2-AMINOETHANESULFONIC ACID SODIUM SALT;N,N-BIS(2-HYDROXYETHYL)-2-AMINOETHANESULPHONIC ACID SODIUM SALT;N,N-BIS(HYDROXYETHYL)-2-AMINOETHANESULFONIC ACID SODIUM SALT;2-[BIS(2-HYDROXYETHYL)AMINO]ETHANESULFONIC ACID SODIUM SALT;2-[N,N-BIS(2-HYDROXYETHYL)AMINO]ETHANESULFONICACID,SODIUMSALT(BES-NA);N,N-Bis(2-hydroxyethyl)-2-aminoethanesulphonic acid sodium salt >99%;2-[N,N-Bis(2-hydroxyethyl)amino]-1-ethanesulfonic acid sodium salt;BES-NA | | CAS: | 66992-27-6 | | MF: | C6H14NNaO5S | | MW: | 235.23 | | EINECS: | 640-879-3 | | Product Categories: | buffer;Pharmaceutical Intermediates | | Mol File: | 66992-27-6.mol |  |
| | N,N-Bis(2-hydroxyethyl)-2-aminoethanesulfonic acid sodium salt Chemical Properties |
| storage temp. | Store at RT. | | solubility | H2O: 0.35 g/mL, clear, colorless | | form | Powder or Crystalline Powder | | color | White | | PH | 6.4-7.8 | | PH Range | 6.4 - 7.8 | | pka | 7.1 (Free acid)(at 25℃) | | Water Solubility | water: 333.3mg/mL, clear, colorless | | InChI | InChI=1S/C6H15NO5S.Na/c8-4-1-7(2-5-9)3-6-13(10,11)12;/h8-9H,1-6H2,(H,10,11,12);/q;+1/p-1 | | InChIKey | CFQLQLSIZOWFNV-UHFFFAOYSA-M | | SMILES | S([O-])(=O)(=O)CCN(CCO)CCO.[Na+] | | CAS DataBase Reference | 66992-27-6(CAS DataBase Reference) |
| | N,N-Bis(2-hydroxyethyl)-2-aminoethanesulfonic acid sodium salt Usage And Synthesis |
| Chemical Properties | White solid | | Uses | diagnostic assay manufacturing |
| | N,N-Bis(2-hydroxyethyl)-2-aminoethanesulfonic acid sodium salt Preparation Products And Raw materials |
|