|
|
| | 4-Fluoro-2-nitrobenzeneamine Basic information |
| | 4-Fluoro-2-nitrobenzeneamine Chemical Properties |
| Melting point | 90-94 °C (lit.) | | Boiling point | 295.1±20.0 °C(Predicted) | | density | 1.3822 (estimate) | | Fp | 193 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | -0.11±0.10(Predicted) | | form | Crystalline Powder | | color | Orange to brown | | Water Solubility | INSOLUBLE | | BRN | 2210197 | | InChI | InChI=1S/C6H5FN2O2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H,8H2 | | InChIKey | PUGDHSSOXPHLPT-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(F)C=C1[N+]([O-])=O | | CAS DataBase Reference | 364-78-3(CAS DataBase Reference) | | NIST Chemistry Reference | 4-Fluoro-2-nitroaniline(364-78-3) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36/37-36/37/39 | | RIDADR | 2811 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29214200 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-Fluoro-2-nitrobenzeneamine Usage And Synthesis |
| Chemical Properties | orange to brown crystalline powder | | Uses | 4-Fluoro-2-nitroaniline is used as a reagent in the preparation of 4-fluoro-o-phenylenediamine, 4-fluoro-N-ethyl-2-nitroaniline and N-(4-fluoro-2-nitrophenyl)-beta-alanine. It is also employed as a pharmaceutical intermediate. It acts as monodendate O-bonded ligand used in the coordination chemistry to form complexes with copper(II), nickel(II) and cobalt(II). | | Uses | 4-Fluoro-2-nitroaniline was used as starting reagent in the synthesis of 4-fluoro-N-ethyl-2-nitroaniline and N-(4-fluoro-2-nitrophenyl)-β-alanine. | | General Description | 4-Fluoro-2-nitroaniline forms complexes with cobalt(II), nickel(II) and copper(II). |
| | 4-Fluoro-2-nitrobenzeneamine Preparation Products And Raw materials |
|