|
|
| | 1-Anthraquinonesulfonic acid sodium salt Basic information |
| | 1-Anthraquinonesulfonic acid sodium salt Chemical Properties |
| storage temp. | Store at room temperature | | form | powder to crystal | | color | Light orange to Yellow to Green | | Water Solubility | MODERATELY SOLUBLE | | InChI | InChI=1S/C14H8O5S.Na.H/c15-13-8-4-1-2-5-9(8)14(16)12-10(13)6-3-7-11(12)20(17,18)19;;/h1-7H,(H,17,18,19);; | | InChIKey | QEVFVAYERYFCBR-UHFFFAOYSA-N | | SMILES | S(C1=CC=CC2C(C3=CC=CC=C3C(=O)C1=2)=O)(O)(=O)=O.[NaH] | | CAS DataBase Reference | 128-56-3(CAS DataBase Reference) | | EPA Substance Registry System | Sodium anthraquinone-1-sulfonate (128-56-3) |
| Safety Statements | 24/25 | | RTECS | CB1095540 | | TSCA | TSCA listed | | HS Code | 29143990 | | Hazardous Substances Data | 128-56-3(Hazardous Substances Data) | | Toxicity | guinea pig,LD50,oral,32gm/kg (32000mg/kg),LIVER: LIVER FUNCTION TESTS IMPAIREDKIDNEY, URETER, AND BLADDER: RENAL FUNCTION TESTS DEPRESSED,Gigiena i Sanitariya. For English translation, see HYSAAV. Vol. 45(3), Pg. 73, 1980. |
| Provider | Language |
|
ACROS
| English |
| | 1-Anthraquinonesulfonic acid sodium salt Usage And Synthesis |
| Chemical Properties | cream to yellow moist paste | | Uses | Sodium Anthraquinone-1-sulfonate (cas# 128-56-3) is a compound useful in organic synthesis. |
| | 1-Anthraquinonesulfonic acid sodium salt Preparation Products And Raw materials |
|