|
|
| | 4-Epoxypropanoxycarbazole Basic information |
| | 4-Epoxypropanoxycarbazole Chemical Properties |
| Melting point | 130-132°C | | Boiling point | 464.9±15.0 °C(Predicted) | | density | 1.327±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 16.59±0.30(Predicted) | | color | Off-White to Light Brown | | BRN | 918742 | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1S/C15H13NO2/c1-2-5-12-11(4-1)15-13(16-12)6-3-7-14(15)18-9-10-8-17-10/h1-7,10,16H,8-9H2 | | InChIKey | SVWKIGRDISDRLO-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2)C2=C1C=CC=C2OCC1CO1 | | CAS DataBase Reference | 51997-51-4(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 43-68 | | Safety Statements | 36/37 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Muta. 2 Skin Sens. 1B |
| | 4-Epoxypropanoxycarbazole Usage And Synthesis |
| Chemical Properties | Pale Yellow to Almost White Powder | | Uses | 4-(2,3-Epoxypropoxy)carbazole (Carvedilol EP Impurity D; Carvedilol USP-D) is an intermediate in the synthesis of Carvedilol (C184625). |
| | 4-Epoxypropanoxycarbazole Preparation Products And Raw materials |
|