- GLYCODEOXYCHOLIC ACID
-
- $0.00 / 1G/KG
-
2026-01-24
- CAS:360-65-6
- Min. Order: 1G/KG
- Purity: 99%
- Supply Ability: 1000000KG
- (GDCA)
-
- $6.00 / 25kg
-
2026-01-24
- CAS:360-65-6
- Min. Order: 1kg
- Purity: 99.99
- Supply Ability: 1000000
|
| | GLYCODEOXYCHOLIC ACID Basic information |
| Product Name: | GLYCODEOXYCHOLIC ACID | | Synonyms: | deoxycholylglycine;glycodeoxy-5-beta-cholan-24-oicaci;glykodesoxycholsaeure;n-((3-alpha,5-beta,12-alpha)-3,12-dihydroxy-24-oxocholan-24-yl)-glycine;n-(3-alpha,12-alpha-dihydroxy-5-beta-cholan-24-yl)-glycin;3α,12α-Dihydroxy-5β-cholanoic acid N-(carboxymethyl)amide;N-(3α,12α-Dihydroxy-24-oxocholan-24-yl)glycine;2-[4-[(3R,5R,10R,12S,13R)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentylamino]acetic acid | | CAS: | 360-65-6 | | MF: | C26H43NO5 | | MW: | 449.63 | | EINECS: | | | Product Categories: | | | Mol File: | 360-65-6.mol |  |
| | GLYCODEOXYCHOLIC ACID Chemical Properties |
| Melting point | 184 °C | | Boiling point | 655.6±50.0 °C(Predicted) | | density | 1.162±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Acetonitrile (Slightly), Ethanol (Slightly), Methanol (Slightly) | | pka | pKa 3.87±0.06(H2O,t = 25.0±0.1,I=0.00) (Uncertain) | | form | Solid | | color | White to Off-White | | InChIKey | WVULKSPCQVQLCU-XHOVQGJQNA-N | | SMILES | C[C@]12[C@H](C[C@]3([H])[C@]4(CC[C@@H](O)C[C@@]4([H])CC[C@@]3([H])[C@]1([H])CC[C@]2([H])[C@H](C)CCC(=O)NCC(=O)O)C)O |&1:1,2,4,6,9,12,16,18,22,24,r| |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | RTECS | MB9670000 | | F | 10 | | Storage Class | 11 - Combustible Solids | | Toxicity | mouse,LD50,intravenous,140mg/kg (140mg/kg),Arzneimittel-Forschung. Drug Research. Vol. 20, Pg. 323, 1970. |
| | GLYCODEOXYCHOLIC ACID Usage And Synthesis |
| Uses | Glycodeoxycholic Acid is a bile acid that induces severe pancreatitis in rats. | | Definition | ChEBI: Glycodeoxycholic acid is a bile acid glycine conjugate of deoxycholic acid. It has a role as a human metabolite. It is functionally related to a deoxycholic acid. It is a conjugate acid of a glycodeoxycholate. | | in vivo | Glycodeoxycholic Acid (11.20 mg/kg, biliary and pancreatic duct injection) can induce acute pancreatitis in rhesus monkeys[3].
| Animal Model: | Experimental macaque model[3] | | Dosage: | 11.20 mg/kg | | Administration: | injected along the biliopancreatic duct | | Result: | Increased the levels of Serum amylase and lipase.
Elevated Blood pressure and heart rate.
|
| | Purification Methods | Glycodeoxycholic acid recrystallises from H2O or aqueous EtOH with 1 mol of H2O and is dried at 100o in vacuo. Its solubility in EtOH is ~5%. [UV: Lindstedt & Sj.vall Acta Chem Scand 11 421 1957.] The Na salt recrystallises from EtOH/Et2O with m 245-250o and [] D23 +41.2o (c 1, H2O) [Wieland Hoppe Seyler's Z Physiol Chem 106 181 1919, Cortese J Am Chem Soc 59 2532 1937]. [Beilstein 10 IV 1611.] |
| | GLYCODEOXYCHOLIC ACID Preparation Products And Raw materials |
|