|
|
| | 3,5,6-Trichlorosalicylic acid Basic information |
| Product Name: | 3,5,6-Trichlorosalicylic acid | | Synonyms: | 2,3,5-trichloro-6-hydroxybenzoate;3,5,6-Trichlorosalicylic acid 98%;3,5,6-Trichlorosalic;Benzoic acid, 2,3,5-trichloro-6-hydroxy-;Trichlorosalicylic Aci;2-HYDROXY-3,5,6-TRICHLOROBENZOIC ACID;3,5,6-TRICHLORO-2-HYDROXYBENZOIC ACID;3,5,6-TRICHLOROSALICYLIC ACID | | CAS: | 40932-60-3 | | MF: | C7H3Cl3O3 | | MW: | 241.46 | | EINECS: | 255-144-9 | | Product Categories: | Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts;Organic acids;Pharmaceutical Intermediate | | Mol File: | 40932-60-3.mol |  |
| | 3,5,6-Trichlorosalicylic acid Chemical Properties |
| Melting point | 209-211 °C(lit.) | | Boiling point | 335.0±42.0 °C(Predicted) | | density | 1.772±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 1.50±0.25(Predicted) | | form | Solid | | color | White to Off-White | | Water Solubility | It has limited solubility in water. | | BRN | 2940592 | | Stability: | Hygroscopic | | Major Application | pharmaceutical
pharmaceutical small molecule | | InChI | InChI=1S/C7H3Cl3O3/c8-2-1-3(9)6(11)4(5(2)10)7(12)13/h1,11H,(H,12,13) | | InChIKey | IIHCUZVBIMTHEB-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=C(O)C(Cl)=CC(Cl)=C1Cl | | CAS DataBase Reference | 40932-60-3(CAS DataBase Reference) | | EPA Substance Registry System | Benzoic acid, 2,3,5-trichloro-6-hydroxy- (40932-60-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2918999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3,5,6-Trichlorosalicylic acid Usage And Synthesis |
| Uses | 3,5,6-Trichlorosalicylic acid is a chlorinated salicylic acid intermediate. |
| | 3,5,6-Trichlorosalicylic acid Preparation Products And Raw materials |
|