| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Etaconazole
CAS:60207-93-4
Purity:100 μg/ML in MeOH Package:10Mg
|
| Company Name: |
Sichuan Kulinan Technology Co., Ltd
|
| Tel: |
400-1166-196 18981987031 |
| Email: |
cdhxsj@163.com |
| Products Intro: |
Product Name:ETACONAZOLE
CAS:60207-93-4
Purity:99% HPLC Package:10g;50g;100g;500g;1kg;5kg;25kg
|
|
| | ETACONAZOLE Basic information |
| Product Name: | ETACONAZOLE | | Synonyms: | ETACONAZOL;ETACONAZOLE;(+/-)-1-[2-(2,4-DICHLOROPHENYL)-4-ETHYL-1,3-DIOXOLAN-2-YL]-1H-1,2,4-TRIAZOLE;1h-1,2,4-triazole,1-((2-(2,4-dichlorophenyl)-4-ethyl-1,3-dioxolan-2-yl)methyl);4-triazole,1-((2-(2,4-dichlorophenyl)-4-ethyl-1,3-dioxolan-2-yl)methyl)-1h-2;benit;cga64251;sonax | | CAS: | 60207-93-4 | | MF: | C14H15Cl2N3O2 | | MW: | 328.19 | | EINECS: | 262-107-0 | | Product Categories: | | | Mol File: | 60207-93-4.mol |  |
| | ETACONAZOLE Chemical Properties |
| Melting point | 75-93℃ | | Boiling point | 470.2±55.0 °C(Predicted) | | density | 1.5146 (rough estimate) | | refractive index | 1.6070 (estimate) | | storage temp. | -20°C | | pka | 2.94±0.12(Predicted) | | Henry's Law Constant | 7.9×103 mol/(m3Pa) at 25℃, MacBean (2012) | | Major Application | agriculture
environmental | | InChI | 1S/C14H15Cl2N3O2/c1-2-11-6-20-14(21-11,7-19-9-17-8-18-19)12-4-3-10(15)5-13(12)16/h3-5,8-9,11H,2,6-7H2,1H3 | | InChIKey | DWRKFAJEBUWTQM-UHFFFAOYSA-N | | SMILES | CCC1COC(Cn2cncn2)(O1)c3ccc(Cl)cc3Cl | | EPA Substance Registry System | Etaconazole (60207-93-4) |
| WGK Germany | WGK 3 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | ETACONAZOLE Usage And Synthesis |
| Chemical Properties | Colorless crystal. Melting point 75-93℃. Melting point of its nitrate 122 ° C. Solubility at 20 ° C (g/kg): acetone 300, dichloromethane 700, methanol 400, isopropanol 100, toluene 250, water 0.08. | | Uses | Etaconazol is a pesticide and fungicide. | | Definition | ChEBI: A member of the class of dioxolanes that is 1,3-dioxolane substituted at position 2 by 2,4-dichlorophenyl and 1,2,4-triazol-1-ylmethyl groups and at position 4 by an ethyl group. An obsolete fungicide that was used to control powdery mildew on fruit and ot
er crops. |
| | ETACONAZOLE Preparation Products And Raw materials |
|