|
|
| | 4,4'-Dinitrodiphenyl disulfide Basic information |
| | 4,4'-Dinitrodiphenyl disulfide Chemical Properties |
| Melting point | 181.0 to 186.0 °C | | Boiling point | 478.8±30.0 °C(Predicted) | | density | 1.5285 (rough estimate) | | refractive index | 1.6510 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Yellow | | Stability: | Stable. Incompatible with strong oxidizing agents, strong bases. | | InChI | InChI=1S/C12H8N2O4S2/c15-13(16)9-1-5-11(6-2-9)19-20-12-7-3-10(4-8-12)14(17)18/h1-8H | | InChIKey | KWGZRLZJBLEVFZ-UHFFFAOYSA-N | | SMILES | S(C1=CC=C([N+]([O-])=O)C=C1)SC1=CC=C([N+]([O-])=O)C=C1 | | CAS DataBase Reference | 100-32-3(CAS DataBase Reference) | | NIST Chemistry Reference | Di-4-nitrophenyl sulfide(100-32-3) | | EPA Substance Registry System | Disulfide, bis(4-nitrophenyl) (100-32-3) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-40 | | Safety Statements | 36 | | WGK Germany | 3 | | RTECS | JO1550000 | | TSCA | TSCA listed | | HS Code | 29309090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 |
| | 4,4'-Dinitrodiphenyl disulfide Usage And Synthesis |
| Chemical Properties | yellow or tan powder | | Uses | Reactant or reagent involved in:• ;Electrophilic cyclization of 2-alkynylanisoles1 or alkynylanilines2• ;Oxidative chlorination to sulfonyl chlorides3• ;Arylation with triarylbismuthanes4• ;Decarboxylative cross-coupling with dialkoxybenzoic acids5• ;Disulfidation of alkenes6 | | Uses | Reactant or reagent involved in:
- Electrophilic cyclization of 2-alkynylanisoles or alkynylanilines
- Oxidative chlorination to sulfonyl chlorides
- Arylation with triarylbismuthanes
- Decarboxylative cross-coupling with dialkoxybenzoic acids
- Disulfidation of alkenes
|
| | 4,4'-Dinitrodiphenyl disulfide Preparation Products And Raw materials |
|