|
|
| | 1,5-DIMETHYL-1H-PYRAZOLE-3-CARBOXYLIC ACID Basic information |
| | 1,5-DIMETHYL-1H-PYRAZOLE-3-CARBOXYLIC ACID Chemical Properties |
| Melting point | 170-176 °C | | Boiling point | 302.4±22.0 °C(Predicted) | | density | 1.28±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | Solid | | pka | 4.12±0.10(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C6H8N2O2/c1-4-3-5(6(9)10)7-8(4)2/h3H,1-2H3,(H,9,10) | | InChIKey | PXRXGHUTKHXUGF-UHFFFAOYSA-N | | SMILES | N1(C)C(C)=CC(C(O)=O)=N1 | | CAS DataBase Reference | 5744-59-2(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36/37/39-37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29331990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,5-DIMETHYL-1H-PYRAZOLE-3-CARBOXYLIC ACID Usage And Synthesis |
| Chemical Properties | White solid | | Uses | 1,5-Dimethyl-1H-pyrazole-3-carboxylic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| | 1,5-DIMETHYL-1H-PYRAZOLE-3-CARBOXYLIC ACID Preparation Products And Raw materials |
|