|
|
| | 1H,1H,2H-Perfluoro-1-decene Basic information |
| Product Name: | 1H,1H,2H-Perfluoro-1-decene | | Synonyms: | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluoro-1-decene,99%;(Perfluoroct-1-yl)ethylene, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluorodec-1-ene;1H,1H,2H-Heptadecafluorodec-1-ene 97%;1H,1H,2H-Perfluoro-1-decene 99%;1,1,2-Trihydroperfluoro-1-decene;1H,1H,2H-PERFLUORODEC-1-ENE;1H,1H,2H-PERFLUORO-1-DECENE;1H,1H,2H-HEPTADECAFLUORO-1-DECENE | | CAS: | 21652-58-4 | | MF: | C10H3F17 | | MW: | 446.1 | | EINECS: | 244-503-5 | | Product Categories: | Fluorous Compounds;Synthetic Organic Chemistry;Fluorous Chemistry | | Mol File: | 21652-58-4.mol |  |
| | 1H,1H,2H-Perfluoro-1-decene Chemical Properties |
| Boiling point | 146-147 °C | | density | 1.677 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.301(lit.) | | Fp | >230 °F | | storage temp. | Refrigerator | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Oil | | color | Colourless | | Specific Gravity | 1.677 | | Water Solubility | Insoluble in water. | | BRN | 2066558 | | Henry's Law Constant | 1.4×10-7 mol/(m3Pa) at 25℃, Goss et al. (2006) | | InChI | 1S/C10H3F17/c1-2-3(11,12)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)9(23,24)10(25,26)27/h2H,1H2 | | InChIKey | NKAMGQZDVMQEJL-UHFFFAOYSA-N | | SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C=C | | CAS DataBase Reference | 21652-58-4(CAS DataBase Reference) | | NIST Chemistry Reference | 1h,1h,2h-Perfluoro-1-decene(21652-58-4) | | EPA Substance Registry System | Perfluorooctyl Ethylene (21652-58-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | 1993 | | WGK Germany | 3 | | Hazard Note | Harmful | | TSCA | TSCA listed | | HazardClass | 3.2 | | PackingGroup | III | | HS Code | 29033990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Dam. 1 Lact. Repr. 1B STOT RE 1 |
| | 1H,1H,2H-Perfluoro-1-decene Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | 1H,1H,2H-Perfluoro-1-decene is useful in the chemical process of making an electrolyte-phobic surface for next generation nanostructured battery electrodes. | | Synthesis | 98% sodium hydroxide 108.535 mmol and methanol 38.74g were introduced into a 200mL eggplant flask which was equipped with a Dimroth condenser, the mixture was stirred at 50 °C until sodium hydroxide was dissolved. Sodium hydroxide amount to 1 liter of methanol in this case was 2.17 mol. After the sodium hydroxide had dissolved 1H, 1H, 2H, 2H-1-iodoperfluorodecane 104.996mmol was charged and further stirred for 2 hours at 50 °C. Heating and stirring were stopped, the obtained two-layer solution which became slightly pale brown turbid was separated after standing, and 45.81g lower layer was collected as 1H,1H,2H-perfluorodecene. As a result of analysis by gas chromatography, purity was 98.59%. The weight of the separated methanol layer was 56.10g.
 |
| | 1H,1H,2H-Perfluoro-1-decene Preparation Products And Raw materials |
| Preparation Products | 1H,1H,2H,2H-PERFLUORODECYLMETHYLDICHLOROSILANE-->1H,1H,2H,2H-Perfluorodecyltrichlorosilane-->2-Bromo-1H,1H-perfluorodec-1-en-->1H,1H,2H,2H-Perfluorodecyltriethoxysilane |
|