|
|
| | 1,1,4,7,10,10-HEXAMETHYLTRIETHYLENETETRAMINE Basic information |
| Product Name: | 1,1,4,7,10,10-HEXAMETHYLTRIETHYLENETETRAMINE | | Synonyms: | 1,1,4,7,10,10-hexamethyl-triethylenetetramin;hexamethyltriethylenetetramine;n,n’-bis(2-(dimethylamino)ethyl)-n,n’-dimethyl-1,2-ethanediamine;n,n’-bis(2-(dimethylamino)ethyl)-n,n’-dimethyl-2-ethanediamine;n,n’-bis[2-(dimethylamino)ethyl]-n,n’-dimethyl-2-ethanediamine;N,N'-bis[2-(dimethylamino)ethyl]-N,N'-dimethylethylenediamine;1,1,4,7,10,10-HEXAMETHYLTRIETHYLENETETRAMINE;1,1,4,7,10,10-Hexamethyltriethylenetetramine ,97% | | CAS: | 3083-10-1 | | MF: | C12H30N4 | | MW: | 230.39 | | EINECS: | 221-382-7 | | Product Categories: | Nitrogen Compounds;Organic Building Blocks;Polyamines | | Mol File: | 3083-10-1.mol |  |
| | 1,1,4,7,10,10-HEXAMETHYLTRIETHYLENETETRAMINE Chemical Properties |
| Melting point | 162 °C | | Boiling point | 130 °C/11 mmHg (lit.) | | density | 0.847 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.456(lit.) | | Fp | 215 °F | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 8.83±0.38(Predicted) | | form | clear liquid | | color | Colorless to Light orange to Yellow | | Water Solubility | Soluble in water. | | Stability: | Stable. Incompatible with strong oxidizing agents. | | InChI | InChI=1S/C12H30N4/c1-13(2)7-9-15(5)11-12-16(6)10-8-14(3)4/h7-12H2,1-6H3 | | InChIKey | DWFKOMDBEKIATP-UHFFFAOYSA-N | | SMILES | C(N(CCN(C)C)C)CN(CCN(C)C)C | | CAS DataBase Reference | 3083-10-1 | | EPA Substance Registry System | 1,2-Ethanediamine, N,N'-bis[2-(dimethylamino)ethyl]-N,N'-dimethyl- (3083-10-1) |
| Hazard Codes | Xi,C | | Risk Statements | 36/37/38-34 | | Safety Statements | 26-37/39-45-36/37/39 | | RIDADR | UN 2735 8/PG 2 | | WGK Germany | 3 | | RTECS | KH8587135 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29212900 | | Storage Class | 8A - Combustible corrosive hazardous materials |
| | 1,1,4,7,10,10-HEXAMETHYLTRIETHYLENETETRAMINE Usage And Synthesis |
| Chemical Properties | Colorless to yellow liquid | | Uses | 1,1,4,7,10,10-Hexamethyltriethylenetetramine may be used as reagent in the synthesis of ideal linear random copolymers containing both vinyl polymer and polyester units in a single polymer chain. 1,1,4,7,10,10-Hexamethyltriethylenetetramine complexed with CuBr constitutes catalytic complex, used in the copolymerization of poly[ε-caprolactone] with N,N-dimethylamino-2-ethyl methacrylate monomers by atom-transfer radical polymerization (ATRP). It may be used as catalyst in the aqueous surface-initiated-ATRP to grow poly(N,N-dimethylacrylamide) (PDMA). | | Uses | suzuki reaction | | General Description | 1,1,4,7,10,10-Hexamethyltriethylenetetramine is a polyamines additive, has been reported as an efficient reagent for the problematic Koenigs-Knorr glucuronidation. |
| | 1,1,4,7,10,10-HEXAMETHYLTRIETHYLENETETRAMINE Preparation Products And Raw materials |
|