|
|
| | trans-4-Hydroxy-D-proline Basic information |
| | trans-4-Hydroxy-D-proline Chemical Properties |
| Melting point | 260°C | | Boiling point | 355.2±42.0 °C(Predicted) | | density | 1.395±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 2.14±0.40(Predicted) | | form | powder | | color | White to off-white | | Major Application | peptide synthesis | | InChI | InChI=1S/C5H9NO3/c7-3-1-4(5(8)9)6-2-3/h3-4,6-7H,1-2H2,(H,8,9)/t3-,4+/m0/s1 | | InChIKey | PMMYEEVYMWASQN-IUYQGCFVSA-N | | SMILES | C(O)(=O)[C@H]1C[C@H](O)CN1 | | CAS DataBase Reference | 3398-22-9(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38-43 | | Safety Statements | 24/25-36/37-26 | | WGK Germany | 3 | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Resp. Sens. 1
Skin Irrit. 2
STOT SE 3 |
| | trans-4-Hydroxy-D-proline Usage And Synthesis |
| Chemical Properties | White to pale pink solid | | Uses | peptide synthesis | | Definition | ChEBI: Trans-4-hydroxy-D-proline is a 4-hydroxy-D-proline in which the hydroxy group at position 4 has S-configuration. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | trans-4-Hydroxy-D-proline Preparation Products And Raw materials |
| Raw materials | D-Proline, 1-acetyl-4-[[(4-methylphenyl)sulfonyl]oxy]-, methyl ester, cis- (9CI)-->D-Proline, 4-hydroxy-, (4S)-rel--->L-Hydroxyproline | | Preparation Products | (2R,4S)-N-ALPHA-T-BUTOXYCARBONYL-4-HYDROXYPYRROLIDINE-2-CARBOXYLIC ACID-->(2S,4R)-Methyl 4-hydroxypyrrolidine-2-carboxylate-->D-Proline, 4-hydroxy-, methyl ester, (4S)- (9CI) |
|