|
|
| | S-Boc-2-mercapto-4,6-dimethylpyrimidine Basic information |
| | S-Boc-2-mercapto-4,6-dimethylpyrimidine Chemical Properties |
| Melting point | 48-51 °C (lit.) | | Boiling point | 358.8±45.0 °C(Predicted) | | density | 1.15±0.1 g/cm3(Predicted) | | Fp | >230 °F | | storage temp. | 2-8°C | | pka | 0.12±0.50(Predicted) | | form | crystals | | Appearance | White to light yellow Solid | | BRN | 396984 | | InChI | InChI=1S/C11H16N2O2S/c1-7-6-8(2)13-9(12-7)16-10(14)15-11(3,4)5/h6H,1-5H3 | | InChIKey | POTDIELOEHTPJN-UHFFFAOYSA-N | | SMILES | C(SC1=NC(C)=CC(C)=N1)(=O)OC(C)(C)C | | CAS DataBase Reference | 41840-28-2(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 29335990 | | Storage Class | 11 - Combustible Solids |
| | S-Boc-2-mercapto-4,6-dimethylpyrimidine Usage And Synthesis |
| Chemical Properties | Light yellow to red yellow solid | | Uses | Reagent for the preparation of Boc-amino acids | | Uses | S-Boc-2-mercapto-4,6-dimethylpyrimidine can react with propylamine to produce propyl-carbamic acid tert-butyl ester. It is used as a pharmaceutical intermediate. |
| | S-Boc-2-mercapto-4,6-dimethylpyrimidine Preparation Products And Raw materials |
|