|
|
| | 2,6-DICHLORO-3-NITROBENZONITRILE Basic information |
| Product Name: | 2,6-DICHLORO-3-NITROBENZONITRILE | | Synonyms: | Dichloronitrobenzonitrile;BUTTPARK 52\04-92;2,6-DICHLORO-3-NITROBENZONITRILE;2,6-DICHLORO-3-NITROBENZONITRILE 98%;2,6-dichloro-3-nitrobenzenecarbonitrile;Benzonitrile, 2,6-dichloro-3-nitro-;2,6-dichloro-3-nitorbenzonitirle | | CAS: | 5866-98-8 | | MF: | C7H2Cl2N2O2 | | MW: | 217.01 | | EINECS: | | | Product Categories: | Aromatic Nitriles | | Mol File: | 5866-98-8.mol |  |
| | 2,6-DICHLORO-3-NITROBENZONITRILE Chemical Properties |
| Melting point | 106-109°C | | Boiling point | 341.7±42.0 °C(Predicted) | | density | 1.61±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | Appearance | Light yellow to light brown Solid | | BRN | 2113045 | | InChI | InChI=1S/C7H2Cl2N2O2/c8-5-1-2-6(11(12)13)7(9)4(5)3-10/h1-2H | | InChIKey | NSKVWZIEYFSHIM-UHFFFAOYSA-N | | SMILES | C(#N)C1=C(Cl)C=CC([N+]([O-])=O)=C1Cl | | CAS DataBase Reference | 5866-98-8 |
| Provider | Language |
|
ALFA
| English |
| | 2,6-DICHLORO-3-NITROBENZONITRILE Usage And Synthesis |
| Uses | 2,6-Dichloro-3-nitrobenzonitrile is used as a pharmaceutical intermediate for the preparation of inhibitors of HIV replication. |
| | 2,6-DICHLORO-3-NITROBENZONITRILE Preparation Products And Raw materials |
|