ETHYL 4-METHYL-4-PENTENOATE manufacturers
|
| | ETHYL 4-METHYL-4-PENTENOATE Basic information |
| Product Name: | ETHYL 4-METHYL-4-PENTENOATE | | Synonyms: | ETHYL 4-METHYL-4-PENTENOATE;Ethyl 4-methyl-4-pentenoate,95%;4-Methyl-4-pentenoic acid ethyl ester;ethyl 4-Methyl-pent-4-en-1-oate;Ethyl 4-methyl-4-pentenoate 95%;ethyle4-methyl-4-pentenoate;Ethyl 4-methylpent-4-enoate;4-Pentenoic acid, 4-methyl-, ethyl ester | | CAS: | 4911-54-0 | | MF: | C8H14O2 | | MW: | 142.2 | | EINECS: | | | Product Categories: | C8 to C9;Carbonyl Compounds;Esters | | Mol File: | 4911-54-0.mol |  |
| | ETHYL 4-METHYL-4-PENTENOATE Chemical Properties |
| Melting point | -65.52°C (estimate) | | Boiling point | 85 °C/20 mmHg (lit.) | | density | 0.891 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.425(lit.) | | Fp | 136 °F | | storage temp. | Inert atmosphere,Room Temperature | | form | liquid | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C8H14O2/c1-4-10-8(9)6-5-7(2)3/h2,4-6H2,1,3H3 | | InChIKey | RRTBSPBUHUUTHR-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)CCC(C)=C | | CAS DataBase Reference | 4911-54-0 |
| Risk Statements | 10-36/37/38 | | Safety Statements | 24/25 | | RIDADR | UN 3272 3/PG 3 | | WGK Germany | 3 | | HazardClass | 3.2 | | PackingGroup | III | | HS Code | 29161900 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3 |
| | ETHYL 4-METHYL-4-PENTENOATE Usage And Synthesis |
| Chemical Properties | Clear colorless liquid | | Uses | Ethyl 4-methyl-4-pentenoate is an olefin ester. It undergoes iron carbonyl-promoted isomerization to α,β-unsaturated esters. Reaction of ethyl 4-methyl-4-pentenoate with CH3OBOCH3+ was examined in a small Fourier-transform ion cyclotron resonance mass spectrometer equipped with a permanent magnet. |
| | ETHYL 4-METHYL-4-PENTENOATE Preparation Products And Raw materials |
|