|
|
| | Cythioate Basic information |
| Product Name: | Cythioate | | Synonyms: | CL 26691;CYFLEE(R);CYTHIOATE;O,O-DIMETHYL-O-P-SULFAMOYL-PHENYLPHOSPHOROTHIOATE;PROBAN(R);American CL-26,691;American cl-26691;American Cyanamid CL-26,691 | | CAS: | 115-93-5 | | MF: | C8H12NO5PS2 | | MW: | 297.29 | | EINECS: | 204-115-9 | | Product Categories: | | | Mol File: | 115-93-5.mol |  |
| | Cythioate Chemical Properties |
| Melting point | 70-71° | | Boiling point | 407.7±55.0 °C(Predicted) | | density | 1.459±0.06 g/cm3(Predicted) | | refractive index | nD25 1.5346 | | storage temp. | 2-8°C | | form | Crystalline | | pka | 10.04±0.10(Predicted) | | BRN | 2148114 | | Major Application | agriculture environmental | | InChI | 1S/C8H12NO5PS2/c1-12-15(16,13-2)14-7-3-5-8(6-4-7)17(9,10)11/h3-6H,1-2H3,(H2,9,10,11) | | InChIKey | BSBSDQUZDZXGFN-UHFFFAOYSA-N | | SMILES | COP(=S)(OC)Oc1ccc(cc1)S(N)(=O)=O | | NIST Chemistry Reference | Cythioate(115-93-5) | | EPA Substance Registry System | Cythioate (115-93-5) |
| Hazard Codes | Xn | | Risk Statements | 22 | | RIDADR | 2783 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29350090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral | | Toxicity | LD50 orally in rats: 160 mg/kg (Kenaga, Allison) |
| | Cythioate Usage And Synthesis |
| Description | Cythioate is a member of the organothiophosphate compounds that is used as an insecticide and anthelmintic. It has been sold under the trade names Cyflee and Proban, under which form it has been used for veterinary purposes against fleas. | | Uses | Cythioate is used as pesticide. | | Safety Profile | Poison by ingestion. An
insecticide. When heated to decomposition
it emits very toxic fumes of NOx, PO,, and
SOx | | Toxicity evaluation | Acute oral LD50 for rats: 160 mg/kg |
| | Cythioate Preparation Products And Raw materials |
|